3-Bromo-4-(4-methyl-1-piperazinyl)benzaldehyde structure
|
Common Name | 3-Bromo-4-(4-methyl-1-piperazinyl)benzaldehyde | ||
|---|---|---|---|---|
| CAS Number | 443777-03-5 | Molecular Weight | 283.164 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 392.2±42.0 °C at 760 mmHg | |
| Molecular Formula | C12H15BrN2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 191.0±27.9 °C | |
| Name | 3-Bromo-4-(4-methylpiperazin-1-yl)benzaldehyde |
|---|---|
| Synonym | More Synonyms |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 392.2±42.0 °C at 760 mmHg |
| Molecular Formula | C12H15BrN2O |
| Molecular Weight | 283.164 |
| Flash Point | 191.0±27.9 °C |
| Exact Mass | 282.036774 |
| PSA | 23.55000 |
| LogP | 2.52 |
| Vapour Pressure | 0.0±0.9 mmHg at 25°C |
| Index of Refraction | 1.606 |
| InChIKey | SBYCBJFPQHUWDY-UHFFFAOYSA-N |
| SMILES | CN1CCN(c2ccc(C=O)cc2Br)CC1 |
| HS Code | 2933599090 |
|---|
|
~43%
3-Bromo-4-(4-me... CAS#:443777-03-5 |
| Literature: Nielsen, Simon F.; Larsen, Mogens; Boesen, Thomas; Schonning, Kristian; Kromann, Hasse Journal of Medicinal Chemistry, 2005 , vol. 48, # 7 p. 2667 - 2677 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933599090 |
|---|---|
| Summary | 2933599090. other compounds containing a pyrimidine ring (whether or not hydrogenated) or piperazine ring in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 3-Bromo-4-(4-methyl-1-piperazinyl)benzaldehyde |
| Benzaldehyde, 3-bromo-4-(4-methyl-1-piperazinyl)- |
| 3-Bromo-4-(4-methyl-piperazin-1-yl); -benzaldehyde |
| 3-bromo-4-(4-methylpiperazin-1-yl)benzaldehyde |