2-Fluoro-1,3,5-tris(trifluoromethyl)benzene structure
|
Common Name | 2-Fluoro-1,3,5-tris(trifluoromethyl)benzene | ||
|---|---|---|---|---|
| CAS Number | 444-39-3 | Molecular Weight | 300.09600 | |
| Density | 1.545g/cm3 | Boiling Point | 101.9ºC at 760 mmHg | |
| Molecular Formula | C9H2F10 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 23.1ºC | |
| Name | 2-Fluoro-1,3,5-tris(trifluoromethyl)benzene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.545g/cm3 |
|---|---|
| Boiling Point | 101.9ºC at 760 mmHg |
| Molecular Formula | C9H2F10 |
| Molecular Weight | 300.09600 |
| Flash Point | 23.1ºC |
| Exact Mass | 300.00000 |
| LogP | 4.88210 |
| Vapour Pressure | 39.8mmHg at 25°C |
| Index of Refraction | 1.344 |
| InChIKey | APVYUEZOPMPDLL-UHFFFAOYSA-N |
| SMILES | Fc1c(C(F)(F)F)cc(C(F)(F)F)cc1C(F)(F)F |
| HS Code | 2903999090 |
|---|
|
~%
2-Fluoro-1,3,5-... CAS#:444-39-3 |
| Literature: McBee; Leech Industrial and Engineering Chemistry, 1947 , vol. 39, p. 393 |
|
~%
2-Fluoro-1,3,5-... CAS#:444-39-3 |
| Literature: McBee; Leech Industrial and Engineering Chemistry, 1947 , vol. 39, p. 393 |
|
~%
2-Fluoro-1,3,5-... CAS#:444-39-3 |
| Literature: McBee; Leech Industrial and Engineering Chemistry, 1947 , vol. 39, p. 393 |
| HS Code | 2903999090 |
|---|---|
| Summary | 2903999090 halogenated derivatives of aromatic hydrocarbons VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| 2-fluoro-1,3,5-tris-trifluoromethyl-benzene |
| 2-Fluor-4-nitro-mesitylen |
| 2-fluoro-1,3,5-trimethyl-4-nitro-benzene |
| 2-Fluor-1,3,5-trimethyl-4-nitro-benzol |
| 2-Fluor-1,3,5-tris-trifluormethyl-benzol |
| Fluor-nitromesitylen |