N-(2-trifluoromethylphenyl)-2-oxyiminoacetamide structure
|
Common Name | N-(2-trifluoromethylphenyl)-2-oxyiminoacetamide | ||
|---|---|---|---|---|
| CAS Number | 444-93-9 | Molecular Weight | 232.15900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H7F3N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-(hydroxyamino)-N-[2-(trifluoromethyl)phenyl]acetamide |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C9H7F3N2O2 |
|---|---|
| Molecular Weight | 232.15900 |
| Exact Mass | 232.04600 |
| PSA | 61.69000 |
| LogP | 2.17690 |
| InChIKey | SSAHMDMEYZOZLN-WLRTZDKTSA-N |
| SMILES | O=C(C=NO)Nc1ccccc1C(F)(F)F |
| HS Code | 2928000090 |
|---|
| Precursor 0 | |
|---|---|
| DownStream 3 | |
| HS Code | 2928000090 |
|---|---|
| Summary | 2928000090 other organic derivatives of hydrazine or of hydroxylamine VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
| hydroxyimino-acetic acid-(2-trifluoromethyl-anilide) |
| N-(2-trifluoromethylphenyl)-2-oxyiminoacetamide |
| Hydroxyimino-essigsaeure-(2-trifluormethyl-anilid) |