2-Amino-3-(trifluoromethyl)benzoic acid structure
|
Common Name | 2-Amino-3-(trifluoromethyl)benzoic acid | ||
|---|---|---|---|---|
| CAS Number | 313-12-2 | Molecular Weight | 205.134 | |
| Density | 1.5±0.1 g/cm3 | Boiling Point | 296.9±40.0 °C at 760 mmHg | |
| Molecular Formula | C8H6F3NO2 | Melting Point | 157-160 °C(lit.) | |
| MSDS | Chinese USA | Flash Point | 133.3±27.3 °C | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 2-Amino-3-(trifluoromethyl)benzoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.5±0.1 g/cm3 |
|---|---|
| Boiling Point | 296.9±40.0 °C at 760 mmHg |
| Melting Point | 157-160 °C(lit.) |
| Molecular Formula | C8H6F3NO2 |
| Molecular Weight | 205.134 |
| Flash Point | 133.3±27.3 °C |
| Exact Mass | 205.035065 |
| PSA | 63.32000 |
| LogP | 3.17 |
| Vapour Pressure | 0.0±0.7 mmHg at 25°C |
| Index of Refraction | 1.528 |
| InChIKey | UNLVJVQEDSDPIN-UHFFFAOYSA-N |
| SMILES | Nc1c(C(=O)O)cccc1C(F)(F)F |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi:Irritant; |
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26-S36 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
|
~%
2-Amino-3-(trif... CAS#:313-12-2 |
| Literature: Proceedings of the Royal Society of London, Series B: Biological Sciences, , vol. 148, p. 481,488 Journal of Organic Chemistry, , vol. 22, p. 29,32 |
|
~%
2-Amino-3-(trif... CAS#:313-12-2 |
| Literature: European Journal of Medicinal Chemistry, , vol. 29, # 10 p. 743 - 751 |
|
~%
2-Amino-3-(trif... CAS#:313-12-2 |
| Literature: Angewandte Chemie, , vol. 93, # 10 p. 914 - 915 |
|
~%
2-Amino-3-(trif... CAS#:313-12-2 |
| Literature: DE693610 , ; DRP/DRBP Org.Chem. |
| Precursor 4 | |
|---|---|
| DownStream 8 | |
|
Eur. J. Med. Chem. 29 , 743, (1994)
|
| 3-trifluoromethyl-2-aminobenzoic acid |
| 2-amino-3-trifluoromethyl-benzoic acid |
| 2-Amino-3-(trifluoromethyl)benzoic acid |
| MFCD00274210 |
| 2-AMINO-3-(TRIFLUOROMETHYL)BENZOICACID |