1,3-Dioxo-2-isoindolineethanesulfonic acid structure
|
Common Name | 1,3-Dioxo-2-isoindolineethanesulfonic acid | ||
|---|---|---|---|---|
| CAS Number | 4443-24-7 | Molecular Weight | 255.24700 | |
| Density | 1.608g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C10H9NO5S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-(1,3-Dioxoisoindolin-2-yl)ethanesulfonic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.608g/cm3 |
|---|---|
| Molecular Formula | C10H9NO5S |
| Molecular Weight | 255.24700 |
| Exact Mass | 255.02000 |
| PSA | 100.13000 |
| LogP | 1.18910 |
| Index of Refraction | 1.647 |
| InChIKey | GSLVEXPADWBUAC-UHFFFAOYSA-N |
| SMILES | O=C1c2ccccc2C(=O)N1CCS(=O)(=O)O |
|
~92%
1,3-Dioxo-2-iso... CAS#:4443-24-7 |
| Literature: Shin, Kye Jung; Yoo, Kyung Ho; Kim, Dong Jin; Park, Sang Woo; Ko, Bong Suck; Lee, Sang Joo; Huh, Jae Doo; Park, Seung Yong Bioorganic and Medicinal Chemistry Letters, 1998 , vol. 8, # 13 p. 1607 - 1612 |
|
~%
1,3-Dioxo-2-iso... CAS#:4443-24-7 |
| Literature: Squibb and Sons Patent: US2184279 , 1937 ; |
|
~%
1,3-Dioxo-2-iso... CAS#:4443-24-7 |
| Literature: Oda; Teramura Bl.Inst.chem.Res.Kyoto Univ., 1954 , vol. 32, p. 159,163 |
| 2-(1,3-dioxoisoindol-2-yl)ethanesulfonic acid |
| 1,3-Dioxo-2-isoindolineethanesulfonic acid |
| 1,3-Dioxo-2-isoindolineethanesulfonic acid sodium |