6-iodo-2-methyl-3-(2-methylphenyl)quinazolin-4-one structure
|
Common Name | 6-iodo-2-methyl-3-(2-methylphenyl)quinazolin-4-one | ||
|---|---|---|---|---|
| CAS Number | 4449-73-4 | Molecular Weight | 376.19200 | |
| Density | 1.61g/cm3 | Boiling Point | 481.1ºC at 760 mmHg | |
| Molecular Formula | C16H13IN2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 244.7ºC | |
| Name | 6-iodo-2-methyl-3-(2-methylphenyl)quinazolin-4-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.61g/cm3 |
|---|---|
| Boiling Point | 481.1ºC at 760 mmHg |
| Molecular Formula | C16H13IN2O |
| Molecular Weight | 376.19200 |
| Flash Point | 244.7ºC |
| Exact Mass | 376.00700 |
| PSA | 34.89000 |
| LogP | 3.60710 |
| Index of Refraction | 1.686 |
| InChIKey | FTIBNTFGONFSTH-UHFFFAOYSA-N |
| SMILES | Cc1ccccc1-n1c(C)nc2ccc(I)cc2c1=O |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 6-iodo-2-methyl-3-o-tolyl-3H-quinazolin-4-one |
| 6-Jod-2-methyl-3-o-tolyl-3H-chinazolin-4-on |
| 6-Iod-2-methyl-3-<o-tolyl>-chinazol-4-on |