UNII:DLM851L3RD structure
|
Common Name | UNII:DLM851L3RD | ||
|---|---|---|---|---|
| CAS Number | 444912-53-2 | Molecular Weight | 503.333 | |
| Density | 1.6±0.1 g/cm3 | Boiling Point | 630.7±55.0 °C at 760 mmHg | |
| Molecular Formula | C22H22IN3O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 335.2±31.5 °C | |
Use of UNII:DLM851L3RD(S)-AM1241 binds to cannabinoid (CB) receptors and is selective for CB2 over CB1. (S)-1241 acts as an agonist at human, rat, and mouse CB2 receptors but shows greater activity at human CB2 than at rat and mouse CB2 receptors. Similar to the racemate AM1241, (S)-AM1241 produces antinociception to thermal pain but not mechanical pain in rats. The pain-reducing effect of (S)-AM1241 is blocked by the CB2-specific inhibitor SR 144528 but not by either the CB1-selective inhibitor rimonabant or the opioid receptor blocker naloxone |
| Name | (2-iodo-5-nitrophenyl)-[1-[[(2S)-1-methylpiperidin-2-yl]methyl]indol-3-yl]methanone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.6±0.1 g/cm3 |
|---|---|
| Boiling Point | 630.7±55.0 °C at 760 mmHg |
| Molecular Formula | C22H22IN3O3 |
| Molecular Weight | 503.333 |
| Flash Point | 335.2±31.5 °C |
| Exact Mass | 503.070587 |
| PSA | 71.06000 |
| LogP | 4.85 |
| Vapour Pressure | 0.0±1.8 mmHg at 25°C |
| Index of Refraction | 1.696 |
| InChIKey | ZUHIXXCLLBMBDW-INIZCTEOSA-N |
| SMILES | CN1CCCCC1Cn1cc(C(=O)c2cc([N+](=O)[O-])ccc2I)c2ccccc21 |
| (2-iodo-5-nitrophenyl){1-[(1-methylpiperidin-2-yl)methyl]-1H-indol-3-yl}methanone |
| Methanone, (2-iodo-5-nitrophenyl)[1-[(1-methyl-2-piperidinyl)methyl]-1H-indol-3-yl]- |
| (2-Iodo-5-nitrophenyl){1-[(1-methyl-2-piperidinyl)methyl]-1H-indol-3-yl}methanone |
| (2-Iodo-5-nitrophenyl)(1-{[(2S)-1-methyl-2-piperidinyl]methyl}-1H-indol-3-yl)methanone |
| unii-i104x21i7c |
| UNII:DLM851L3RD |
| Methanone, (2-iodo-5-nitrophenyl)[1-[[(2S)-1-methyl-2-piperidinyl]methyl]-1H-indol-3-yl]- |