3-acetyl-1H-indole-5-carboxylic acid structure
|
Common Name | 3-acetyl-1H-indole-5-carboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 444991-59-7 | Molecular Weight | 203.19400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H9NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3-acetyl-1H-indole-5-carboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C11H9NO3 |
|---|---|
| Molecular Weight | 203.19400 |
| Exact Mass | 203.05800 |
| PSA | 70.16000 |
| LogP | 2.06870 |
| InChIKey | MEYLFQCWVDJSQU-UHFFFAOYSA-N |
| SMILES | CC(=O)c1c[nH]c2ccc(C(=O)O)cc12 |
|
~99%
3-acetyl-1H-ind... CAS#:444991-59-7 |
| Literature: Ludwig, Joachim; Bovens, Stefanie; Brauch, Carsten; Elfringhoff, Alwine Schulze; Lehr, Matthias Journal of Medicinal Chemistry, 2006 , vol. 49, # 8 p. 2611 - 2620 |
|
~%
3-acetyl-1H-ind... CAS#:444991-59-7 |
| Literature: Ludwig, Joachim; Bovens, Stefanie; Brauch, Carsten; Elfringhoff, Alwine Schulze; Lehr, Matthias Journal of Medicinal Chemistry, 2006 , vol. 49, # 8 p. 2611 - 2620 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 3-acetylindole-5-carboxylic acid |
| 3-ethanoyl-1H-indole-5-carboxylic acid |
| F2190-0694 |
| 3-Acetyl-1H-indole-5-carboxylic aci |