4-amino-3,5-dinitrobenzotrifluoride structure
|
Common Name | 4-amino-3,5-dinitrobenzotrifluoride | ||
|---|---|---|---|---|
| CAS Number | 445-66-9 | Molecular Weight | 251.12000 | |
| Density | 1.686 g/cm3 | Boiling Point | 313.1ºC at 760 mmHg | |
| Molecular Formula | C7H4F3N3O4 | Melting Point | 144-149 °C(lit.) | |
| MSDS | Chinese USA | Flash Point | 143.1ºC | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 2,6-Dinitro-4-(trifluoromethyl)aniline |
|---|---|
| Synonym | More Synonyms |
| Density | 1.686 g/cm3 |
|---|---|
| Boiling Point | 313.1ºC at 760 mmHg |
| Melting Point | 144-149 °C(lit.) |
| Molecular Formula | C7H4F3N3O4 |
| Molecular Weight | 251.12000 |
| Flash Point | 143.1ºC |
| Exact Mass | 251.01500 |
| PSA | 117.66000 |
| LogP | 3.73160 |
| InChIKey | VACNDKUQVLNNLD-UHFFFAOYSA-N |
| SMILES | Nc1c([N+](=O)[O-])cc(C(F)(F)F)cc1[N+](=O)[O-] |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi: Irritant; |
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26-S36 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 2921420090 |
|
~%
4-amino-3,5-din... CAS#:445-66-9 |
| Literature: Eli Lilly and Company Patent: US3980784 A1, 1976 ; |
|
~0%
4-amino-3,5-din... CAS#:445-66-9 |
| Literature: Gallardo, Iluminada; Guirado, Gonzalo; Marquet, Jordi European Journal of Inorganic Chemistry, 2002 , # 2 p. 251 - 259 |
|
~%
4-amino-3,5-din... CAS#:445-66-9 |
| Literature: Malichenko,B.F. et al. Sov. Prog. Chem. (Engl. Transl.), 1967 , vol. 33, # 12 p. 1273 - 1275,39 - 41 |
|
~%
4-amino-3,5-din... CAS#:445-66-9
Detail
|
| Literature: Mabury, Scott A.; Crosby, Donald G. Journal of Agricultural and Food Chemistry, 1995 , vol. 43, # 7 p. 1845 - 1848 |
| HS Code | 2921420090 |
|---|---|
| Summary | HS:2921420090 aniline derivatives and their salts VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| 2,6-dinitro-4-(trifluoromethyl)aniline |
| 2,6-DINITRO-4-TRIFLUOROMETHYLANILINE |
| MFCD00024260 |