2-Fluoro-1-methoxy-3-nitrobenzene
2-Fluoro-1-methoxy-3-nitrobenzene structure
|
Common Name | 2-Fluoro-1-methoxy-3-nitrobenzene | ||
|---|---|---|---|---|
| CAS Number | 445-68-1 | Molecular Weight | 171.126 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 278.9±20.0 °C at 760 mmHg | |
| Molecular Formula | C7H6FNO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 122.5±21.8 °C | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-fluoro-1-methoxy-3-nitrobenzene |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 278.9±20.0 °C at 760 mmHg |
| Molecular Formula | C7H6FNO3 |
| Molecular Weight | 171.126 |
| Flash Point | 122.5±21.8 °C |
| Exact Mass | 171.033173 |
| PSA | 55.05000 |
| LogP | 1.86 |
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |
| Index of Refraction | 1.522 |
| InChIKey | WDQHQUDZNPCCAF-UHFFFAOYSA-N |
| SMILES | COc1cccc([N+](=O)[O-])c1F |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 0 | |
|---|---|
| DownStream 1 | |
CAS#:410092-91-0This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 2-Fluoro-1-methoxy-3-nitrobenzene |
| 2-Fluoro-3-nitrophenyl methyl ether |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of 2-fluoro-1-methoxy-3-nitrobenzene? |
| A: Molecular formula of 2-fluoro-1-methoxy-3-nitrobenzene is C7H6FNO3. |
| Q: What are the downstream products of 2-fluoro-1-methoxy-3-nitrobenzene? |
| A: Related downstream products(CAS) of 2-fluoro-1-methoxy-3-nitrobenzene: 410092-91-0. |
| Q: What is the polar surface area (PSA) of 2-fluoro-1-methoxy-3-nitrobenzene? |
| A: Polar surface area (PSA) of 2-fluoro-1-methoxy-3-nitrobenzene is 55.05000. |
| Q: What is the molecular weight of 2-fluoro-1-methoxy-3-nitrobenzene? |
| A: Molecular weight of 2-fluoro-1-methoxy-3-nitrobenzene is 171.126. |
| Q: What English synonyms does 2-fluoro-1-methoxy-3-nitrobenzene have? |
| A: English synonyms of 2-fluoro-1-methoxy-3-nitrobenzene: 2-Fluoro-1-methoxy-3-nitrobenzene, 2-Fluoro-3-nitrophenyl methyl ether. |
| Q: What is the boiling point of 2-fluoro-1-methoxy-3-nitrobenzene? |
| A: Boiling point of 2-fluoro-1-methoxy-3-nitrobenzene is 278.9±20.0 °C at 760 mmHg. |
| Q: What is the LogP of 2-fluoro-1-methoxy-3-nitrobenzene? |
| A: LogP of 2-fluoro-1-methoxy-3-nitrobenzene is 1.86. |
| Q: What is the SMILES notation of 2-fluoro-1-methoxy-3-nitrobenzene? |
| A: SMILES notation of 2-fluoro-1-methoxy-3-nitrobenzene is COc1cccc([N+](=O)[O-])c1F. |
| Q: What is the InChIKey of 2-fluoro-1-methoxy-3-nitrobenzene? |
| A: InChIKey of 2-fluoro-1-methoxy-3-nitrobenzene is WDQHQUDZNPCCAF-UHFFFAOYSA-N. |
| Q: What is the CAS number of 2-fluoro-1-methoxy-3-nitrobenzene? |
| A: CAS number of 2-fluoro-1-methoxy-3-nitrobenzene is 445-68-1. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |
| Dayang Chem (Hangzhou) Co., Ltd. |