4-Fluoro-1-methoxy-2-nitrobenzene structure
|
Common Name | 4-Fluoro-1-methoxy-2-nitrobenzene | ||
|---|---|---|---|---|
| CAS Number | 445-83-0 | Molecular Weight | 171.126 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 272.4±20.0 °C at 760 mmHg | |
| Molecular Formula | C7H6FNO3 | Melting Point | 62-64 °C(lit.) | |
| MSDS | Chinese USA | Flash Point | 118.5±21.8 °C | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 4-Fluoro-2-nitroanisole |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 272.4±20.0 °C at 760 mmHg |
| Melting Point | 62-64 °C(lit.) |
| Molecular Formula | C7H6FNO3 |
| Molecular Weight | 171.126 |
| Flash Point | 118.5±21.8 °C |
| Exact Mass | 171.033173 |
| PSA | 55.05000 |
| LogP | 1.76 |
| Vapour Pressure | 0.0±0.5 mmHg at 25°C |
| Index of Refraction | 1.522 |
| InChIKey | FWLPYISRFBKEKV-UHFFFAOYSA-N |
| SMILES | COc1ccc(F)cc1[N+](=O)[O-] |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi:Irritant; |
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26-S36 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 2909309090 |
| Precursor 8 | |
|---|---|
| DownStream 9 | |
| HS Code | 2909309090 |
|---|---|
| Summary | 2909309090 other aromatic ethers and their halogenated, sulphonated, nitrated or nitrosated derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
|
Photochemical nitration by tetranitromethane. Part 36. Adduct formation in the photochemical reactions of 4-fluoroanisole and 4-fluoro-3-methylanisole. Butts CP, et al.
J. Chem. Soc. Perkin Trans. I 2(9) , 1877-87, (1996)
|
| 4-Fluoro-2-Nitroanisole |
| 4-Fluoro-2-nitrophenyl methyl ether |
| 4-Fluoro-1-methoxy-2-nitrobenzene |
| MFCD00013375 |