1,5-diphenyl-3-nitroformazan structure
|
Common Name | 1,5-diphenyl-3-nitroformazan | ||
|---|---|---|---|---|
| CAS Number | 4453-80-9 | Molecular Weight | 269.25900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H11N5O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1,5-diphenyl-3-nitroformazan |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C13H11N5O2 |
|---|---|
| Molecular Weight | 269.25900 |
| Exact Mass | 269.09100 |
| PSA | 94.93000 |
| LogP | 4.02630 |
| InChIKey | ZURUWJIOBITTCE-OVIREHMNSA-N |
| SMILES | O=[N+]([O-])C(N=Nc1ccccc1)=NNc1ccccc1 |
| HS Code | 2928000090 |
|---|
| HS Code | 2928000090 |
|---|---|
| Summary | 2928000090 other organic derivatives of hydrazine or of hydroxylamine VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
| 3-nitro-1,5-diphenylformazan |
| N.N'-Diphenyl-C-nitro-formazan |
| C-Nitro-formazyl |