Diazene, phenyl(phenyl(phenylhydrazono)methyl) structure
|
Common Name | Diazene, phenyl(phenyl(phenylhydrazono)methyl) | ||
|---|---|---|---|---|
| CAS Number | 531-52-2 | Molecular Weight | 300.357 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 422.3±28.0 °C at 760 mmHg | |
| Molecular Formula | C19H16N4 | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | 209.2±24.0 °C | |
| Symbol |
GHS07, GHS09 |
Signal Word | Warning | |
| Name | Tetrazole Red Formazan |
|---|---|
| Synonym | More Synonyms |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 422.3±28.0 °C at 760 mmHg |
| Molecular Formula | C19H16N4 |
| Molecular Weight | 300.357 |
| Flash Point | 209.2±24.0 °C |
| Exact Mass | 300.137512 |
| PSA | 49.11000 |
| LogP | 5.07 |
| Vapour Pressure | 0.0±1.0 mmHg at 25°C |
| Index of Refraction | 1.617 |
| InChIKey | BEIHVSJTPTXQGB-UHFFFAOYSA-N |
| SMILES | c1ccc(N=NC(=NNc2ccccc2)c2ccccc2)cc1 |
| Storage condition | Store at 2-8 |
| Water Solubility | dioxane: 50 mg/mL, clear |
| Symbol |
GHS07, GHS09 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H302-H400 |
| Precautionary Statements | P273 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xn,N |
| Risk Phrases | R22 |
| Safety Phrases | S60-S61-S24/25-S22 |
| RIDADR | UN 3077 9/PG 3 |
| WGK Germany | 3 |
| HS Code | 2928000090 |
| Precursor 8 | |
|---|---|
| DownStream 4 | |
| HS Code | 2928000090 |
|---|---|
| Summary | 2928000090 other organic derivatives of hydrazine or of hydroxylamine VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
|
F.P. Altman
Prog. Histochem. Cytochem. 9(3) , 51, (1976)
|
| TTC Formazan |
| [(Z)-(Diphenylhydrazono)(phenyl)methyl]diazene |
| MFCD00020647 |
| 1,3,5-Triphenyltetrazolium formazan |
| (E)-1-Phenyl-2-[(Z)-phenyl(phenylhydrazono)methyl]diazene |
| 1,3,5-TriphenylforMazan |
| Triphenylformazan |
| Tetrazolium Red Formazan |
| EINECS 208-509-1 |