1-Bromo-4-fluoro-2-nitrobenzene structure
|
Common Name | 1-Bromo-4-fluoro-2-nitrobenzene | ||
|---|---|---|---|---|
| CAS Number | 446-09-3 | Molecular Weight | 219.996 | |
| Density | 1.8±0.1 g/cm3 | Boiling Point | 220.9±20.0 °C at 760 mmHg | |
| Molecular Formula | C6H3BrFNO2 | Melting Point | 37-39°C | |
| MSDS | N/A | Flash Point | 87.4±21.8 °C | |
| Name | 1-bromo-4-fluoro-2-nitrobenzene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.8±0.1 g/cm3 |
|---|---|
| Boiling Point | 220.9±20.0 °C at 760 mmHg |
| Melting Point | 37-39°C |
| Molecular Formula | C6H3BrFNO2 |
| Molecular Weight | 219.996 |
| Flash Point | 87.4±21.8 °C |
| Exact Mass | 218.933105 |
| PSA | 45.82000 |
| LogP | 2.41 |
| Vapour Pressure | 0.2±0.4 mmHg at 25°C |
| Index of Refraction | 1.580 |
| InChIKey | XRXNWKIKQFEOGO-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1cc(F)ccc1Br |
| Hazard Codes | Xi: Irritant; |
|---|---|
| Risk Phrases | R20/21/22;R36/37/38 |
| Safety Phrases | S26-S36/37/39 |
| RIDADR | UN2811 |
| Packaging Group | III |
| Hazard Class | 6.1 |
| HS Code | 2904909090 |
|
~71%
1-Bromo-4-fluor... CAS#:446-09-3 |
| Literature: Schlosser, Manfred; Ginanneschi, Assunta; Leroux, Frederic European Journal of Organic Chemistry, 2006 , # 13 p. 2956 - 2969 |
|
~%
1-Bromo-4-fluor... CAS#:446-09-3 |
| Literature: Carotti, Andrea; Altomare, Cosimo; Savini, Luisa; Chiasserini, Luisa; Pellerano, Cesare; Mascia, Maria P.; Maciocco, Elisabetta; Busonero, Fabio; Mameli, Manuel; Biggio, Giovanni; Sanna, Enrico Bioorganic and Medicinal Chemistry, 2003 , vol. 11, # 23 p. 5259 - 5272 |
|
~%
1-Bromo-4-fluor... CAS#:446-09-3 |
| Literature: Liedholm,B. Acta Chemica Scandinavica, Series B: Organic Chemistry and Biochemistry, 1976 , vol. 30, p. 141 - 149 |
|
~%
1-Bromo-4-fluor... CAS#:446-09-3 |
| Literature: Liedholm,B. Acta Chemica Scandinavica, Series B: Organic Chemistry and Biochemistry, 1976 , vol. 30, p. 141 - 149 |
| Precursor 4 | |
|---|---|
| DownStream 10 | |
| HS Code | 2904909090 |
|---|---|
| Summary | HS:2904909090 sulphonated, nitrated or nitrosated derivatives of hydrocarbons, whether or not halogenated VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| 1-Bromo-4-fluoro-2-nitrobenzene |
| WNR CF FE |
| MFCD00055530 |
| Benzene, 1-bromo-4-fluoro-2-nitro- |
| benzene,1-bromo-4-fluoro-2-nitro |
| 1-Brom-4-fluor-2-nitro-benzol |
| 1-bromo-2-nitro-4-fluoro-benzene |
| 2-Bromo-5-fluoronitrobenzene |
| 1-bromo-4-fluoro-2-nitro-benzene |
| EINECS 207-160-2 |
| 2-nitro-4-fluoro-bromobenzene |