3-chloro-2-methylbenzenediazonium tetrafluoroborate
3-chloro-2-methylbenzenediazonium tetrafluoroborate structure
|
Common Name | 3-chloro-2-methylbenzenediazonium tetrafluoroborate | ||
|---|---|---|---|---|
| CAS Number | 446-55-9 | Molecular Weight | 240.39400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C7H6BClF4N2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 3-chloro-2-methylbenzenediazonium,tetrafluoroborate |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C7H6BClF4N2 |
|---|---|
| Molecular Weight | 240.39400 |
| Exact Mass | 240.02500 |
| PSA | 28.15000 |
| LogP | 4.43298 |
| InChIKey | FGDIXZONYONKRC-UHFFFAOYSA-N |
| SMILES | Cc1c(Cl)cccc1[N+]#N.F[B-](F)(F)F |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 0 | |
|---|---|
| DownStream 1 | |
CAS#:443-83-4This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 3-Chloro-2-methylbenzenediazonium tetrafluoroborate |
| EINECS 207-172-8 |
| FAST SCARLET TR-SALT |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 446-55-9? |
| A: Chinese name of 446-55-9 is 446-55-9. |
| Q: What is the InChIKey of 3-chloro-2-methylbenzenediazonium,tetrafluoroborate? |
| A: InChIKey of 3-chloro-2-methylbenzenediazonium,tetrafluoroborate is FGDIXZONYONKRC-UHFFFAOYSA-N. |
| Q: What is the molecular weight of 3-chloro-2-methylbenzenediazonium,tetrafluoroborate? |
| A: Molecular weight of 3-chloro-2-methylbenzenediazonium,tetrafluoroborate is 240.39400. |
| Q: What is the CAS number of 3-chloro-2-methylbenzenediazonium,tetrafluoroborate? |
| A: CAS number of 3-chloro-2-methylbenzenediazonium,tetrafluoroborate is 446-55-9. |
| Q: What are the downstream products of 3-chloro-2-methylbenzenediazonium,tetrafluoroborate? |
| A: Related downstream products(CAS) of 3-chloro-2-methylbenzenediazonium,tetrafluoroborate: 443-83-4. |
| Q: What is the English name of 3-chloro-2-methylbenzenediazonium,tetrafluoroborate? |
| A: The English name of 3-chloro-2-methylbenzenediazonium,tetrafluoroborate is 3-chloro-2-methylbenzenediazonium,tetrafluoroborate. |
| Q: What is the molecular formula of 3-chloro-2-methylbenzenediazonium,tetrafluoroborate? |
| A: Molecular formula of 3-chloro-2-methylbenzenediazonium,tetrafluoroborate is C7H6BClF4N2. |
| Q: What is the LogP of 3-chloro-2-methylbenzenediazonium,tetrafluoroborate? |
| A: LogP of 3-chloro-2-methylbenzenediazonium,tetrafluoroborate is 4.43298. |
| Q: What is the polar surface area (PSA) of 3-chloro-2-methylbenzenediazonium,tetrafluoroborate? |
| A: Polar surface area (PSA) of 3-chloro-2-methylbenzenediazonium,tetrafluoroborate is 28.15000. |
| Q: What English synonyms does 3-chloro-2-methylbenzenediazonium,tetrafluoroborate have? |
| A: English synonyms of 3-chloro-2-methylbenzenediazonium,tetrafluoroborate: 3-Chloro-2-methylbenzenediazonium tetrafluoroborate, EINECS 207-172-8, FAST SCARLET TR-SALT. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Dayang Chem (Hangzhou) Co., Ltd. |