HOMOERIODICTYOL structure
|
Common Name | HOMOERIODICTYOL | ||
|---|---|---|---|---|
| CAS Number | 446-71-9 | Molecular Weight | 302.27900 | |
| Density | 1.458g/cm3 | Boiling Point | 583.8ºC at 760mmHg | |
| Molecular Formula | C16H14O6 | Melting Point | 225-227ºC (dec.) | |
| MSDS | N/A | Flash Point | 222.1ºC | |
Use of HOMOERIODICTYOLHomoeriodictyol is a flavonoid metabolite of Eriocitrin in plasma and urine. Eriocitrin is a strong antioxidant agent[1]. |
| Name | homoeriodictyol |
|---|---|
| Synonym | More Synonyms |
| Description | Homoeriodictyol is a flavonoid metabolite of Eriocitrin in plasma and urine. Eriocitrin is a strong antioxidant agent[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.458g/cm3 |
|---|---|
| Boiling Point | 583.8ºC at 760mmHg |
| Melting Point | 225-227ºC (dec.) |
| Molecular Formula | C16H14O6 |
| Molecular Weight | 302.27900 |
| Flash Point | 222.1ºC |
| Exact Mass | 302.07900 |
| PSA | 96.22000 |
| LogP | 2.51850 |
| Vapour Pressure | 3.14E-14mmHg at 25°C |
| Index of Refraction | 1.664 |
| InChIKey | FTODBIPDTXRIGS-ZDUSSCGKSA-N |
| SMILES | COc1cc(C2CC(=O)c3c(O)cc(O)cc3O2)ccc1O |
| Precursor 0 | |
|---|---|
| DownStream 2 | |
| 5,7,4'-Trihydroxy-3'-methoxyflavanone |
| 4'-methoxy-5,7,3'-trihydroxyflavanone |
| cyanidanon-3-methyl ether 1625 |
| Eriodictyonone |
| 4',5,7-trihydroxy-3'-methoxyflavanone |
| Eriodictyol 3'-methyl ether |
| (2S)-5,7-dihydroxy-2-(4-hydroxy-3-methoxyphenyl)-2,3-dihydrochromen-4-one |