2,3,3',4,4',5,5',6-octabromodiphenyl ether
2,3,3',4,4',5,5',6-octabromodiphenyl ether structure
|
Common Name | 2,3,3',4,4',5,5',6-octabromodiphenyl ether | ||
|---|---|---|---|---|
| CAS Number | 446255-56-7 | Molecular Weight | 801.376 | |
| Density | 2.8±0.1 g/cm3 | Boiling Point | 540.2±50.0 °C at 760 mmHg | |
| Molecular Formula | C12H2Br8O | Melting Point | N/A | |
| MSDS | USA | Flash Point | 227.1±28.6 °C | |
| Symbol |
GHS02, GHS07, GHS08, GHS09 |
Signal Word | Danger | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1,2,3,4,5-pentabromo-6-(3,4,5-tribromophenoxy)benzene |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 2.8±0.1 g/cm3 |
|---|---|
| Boiling Point | 540.2±50.0 °C at 760 mmHg |
| Molecular Formula | C12H2Br8O |
| Molecular Weight | 801.376 |
| Flash Point | 227.1±28.6 °C |
| Exact Mass | 793.357178 |
| PSA | 9.23000 |
| LogP | 10.12 |
| Vapour Pressure | 0.0±1.4 mmHg at 25°C |
| Index of Refraction | 1.719 |
| InChIKey | CVMKCYDBEYHNBM-UHFFFAOYSA-N |
| SMILES | Brc1cc(Oc2c(Br)c(Br)c(Br)c(Br)c2Br)cc(Br)c1Br |
| Storage condition | 2-8°C |
This table covers safety warnings, protective measures, incompatible substances and disposal guidelines for this compound.
| Symbol |
GHS02, GHS07, GHS08, GHS09 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H225-H304-H315-H336-H410 |
| Precautionary Statements | P210-P261-P273-P301 + P310-P331-P501 |
| Personal Protective Equipment | Eyeshields;Faceshields;full-face respirator (US);Gloves;multi-purpose combination respirator cartridge (US);type ABEK (EN14387) respirator filter |
| Hazard Codes | F,Xn,N |
| Risk Phrases | 11-38-50/53-65-67 |
| Safety Phrases | 60-61-62 |
| RIDADR | UN 1262 3/PG 2 |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 2,2-DIMETHYLTETRAHYDRO-2H-PYRAN-4-CARBALDEHYDE |
| 2,3,3',4,4',5,5',6-OctaBDE |
| UNII-IC12H1GS4R |
| 2,3,3',4,4',5,5',6-Octabromodiphenyl ether solution |
| PBDE 205 |
| 1,2,3,4,5-Pentabromo-6-(3,4,5-tribromophenoxy)benzene |
| BDE 205 |
| BDE No 205 solution |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of 1,2,3,4,5-pentabromo-6-(3,4,5-tribromophenoxy)benzene? |
| A: SMILES notation of 1,2,3,4,5-pentabromo-6-(3,4,5-tribromophenoxy)benzene is Brc1cc(Oc2c(Br)c(Br)c(Br)c(Br)c2Br)cc(Br)c1Br. |
| Q: What is the safety information for 1,2,3,4,5-pentabromo-6-(3,4,5-tribromophenoxy)benzene? |
| A: Safety information for 1,2,3,4,5-pentabromo-6-(3,4,5-tribromophenoxy)benzene: 60-61-62. |
| Q: What is the polar surface area (PSA) of 1,2,3,4,5-pentabromo-6-(3,4,5-tribromophenoxy)benzene? |
| A: Polar surface area (PSA) of 1,2,3,4,5-pentabromo-6-(3,4,5-tribromophenoxy)benzene is 9.23000. |
| Q: What are the storage conditions for 1,2,3,4,5-pentabromo-6-(3,4,5-tribromophenoxy)benzene? |
| A: Storage conditions for 1,2,3,4,5-pentabromo-6-(3,4,5-tribromophenoxy)benzene: 2-8°C. |
| Q: What is the molecular formula of 1,2,3,4,5-pentabromo-6-(3,4,5-tribromophenoxy)benzene? |
| A: Molecular formula of 1,2,3,4,5-pentabromo-6-(3,4,5-tribromophenoxy)benzene is C12H2Br8O. |
| Q: What is the CAS number of 1,2,3,4,5-pentabromo-6-(3,4,5-tribromophenoxy)benzene? |
| A: CAS number of 1,2,3,4,5-pentabromo-6-(3,4,5-tribromophenoxy)benzene is 446255-56-7. |
| Q: What is the boiling point of 1,2,3,4,5-pentabromo-6-(3,4,5-tribromophenoxy)benzene? |
| A: Boiling point of 1,2,3,4,5-pentabromo-6-(3,4,5-tribromophenoxy)benzene is 540.2±50.0 °C at 760 mmHg. |
| Q: What is the InChIKey of 1,2,3,4,5-pentabromo-6-(3,4,5-tribromophenoxy)benzene? |
| A: InChIKey of 1,2,3,4,5-pentabromo-6-(3,4,5-tribromophenoxy)benzene is CVMKCYDBEYHNBM-UHFFFAOYSA-N. |
| Q: What is the molecular weight of 1,2,3,4,5-pentabromo-6-(3,4,5-tribromophenoxy)benzene? |
| A: Molecular weight of 1,2,3,4,5-pentabromo-6-(3,4,5-tribromophenoxy)benzene is 801.376. |
| Q: What English synonyms does 1,2,3,4,5-pentabromo-6-(3,4,5-tribromophenoxy)benzene have? |
| A: English synonyms of 1,2,3,4,5-pentabromo-6-(3,4,5-tribromophenoxy)benzene: 2,2-DIMETHYLTETRAHYDRO-2H-PYRAN-4-CARBALDEHYDE, 2,3,3',4,4',5,5',6-OctaBDE, UNII-IC12H1GS4R, 2,3,3',4,4',5,5',6-Octabromodiphenyl ether solution, PBDE 205, 1,2,3,4,5-Pentabromo-6-(3,4,5-tribromophenoxy)benzene, BDE 205, BDE No 205 solution. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |