2,6-Dichloro-3-(tributylstannyl)pyrazine structure
|
Common Name | 2,6-Dichloro-3-(tributylstannyl)pyrazine | ||
|---|---|---|---|---|
| CAS Number | 446285-70-7 | Molecular Weight | 438.01400 | |
| Density | 1.260 g/mL at 25 °C | Boiling Point | 415.6ºC at 760 mmHg | |
| Molecular Formula | C16H28Cl2N2Sn | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | 205.1ºC | |
| Name | 2,6-Dichloro-3-(tributylstannyl)pyrazine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.260 g/mL at 25 °C |
|---|---|
| Boiling Point | 415.6ºC at 760 mmHg |
| Molecular Formula | C16H28Cl2N2Sn |
| Molecular Weight | 438.01400 |
| Flash Point | 205.1ºC |
| Exact Mass | 438.06500 |
| PSA | 25.78000 |
| LogP | 5.83950 |
| Index of Refraction | n20/D1.535 |
| InChIKey | IJOQAXKEUUCPAJ-UHFFFAOYSA-N |
| SMILES | CCCC[Sn](CCCC)(CCCC)c1ncc(Cl)nc1Cl |
| Hazard Codes | T |
|---|---|
| RIDADR | UN 2788 6.1 / PGIII |
| HS Code | 2933990090 |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 3,5-Dichloro-2-(tributylstannyl)pyrazine |
| 2,6-Dichloro-3-(tri-n-butylstannyl)pyrazine |
| tributyl-(3,5-dichloropyrazin-2-yl)stannane |