L-Leucine 4-methoxy-β-naphthylamide hydrochloride structure
|
Common Name | L-Leucine 4-methoxy-β-naphthylamide hydrochloride | ||
|---|---|---|---|---|
| CAS Number | 4467-68-9 | Molecular Weight | 322.83 | |
| Density | N/A | Boiling Point | 493.9ºC at 760 mmHg | |
| Molecular Formula | C17H23ClN2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 252.5ºC | |
Use of L-Leucine 4-methoxy-β-naphthylamide hydrochlorideL-Leucine 4-methoxy-β-naphthylamide hydrochloride is an aminopeptidase M and leucine aminopeptidase substrate[1]. |
| Name | (2S)-2-amino-N-(4-methoxynaphthalen-2-yl)-4-methylpentanamide,hydrochloride |
|---|---|
| Synonym | More Synonyms |
| Description | L-Leucine 4-methoxy-β-naphthylamide hydrochloride is an aminopeptidase M and leucine aminopeptidase substrate[1]. |
|---|---|
| Related Catalog | |
| Target |
IC50: Substrate[1] |
| References |
| Boiling Point | 493.9ºC at 760 mmHg |
|---|---|
| Molecular Formula | C17H23ClN2O2 |
| Molecular Weight | 322.83 |
| Flash Point | 252.5ºC |
| Exact Mass | 322.144806 |
| PSA | 64.35000 |
| LogP | 4.73560 |
| InChIKey | NECOEODWTUWPBP-RSAXXLAASA-N |
| SMILES | COc1cc(NC(=O)C(N)CC(C)C)cc2ccccc12.Cl |
| L-Leucine 4-methoxy-|A-naphthylamide hydrochloride |
| Valeramide,2-amino-4-methyl-N-(4-methoxy-2-naphthyl)-,hydrochloride,L-(8CI) |
| Pentanamide, 2-amino-N-(4-methoxy-2-naphthalenyl)-4-methyl-, (2S)-, hydrochloride (1:1) |
| (S)-2-Amino-N-(4-methoxy-2-naphthyl)-4-methylvaleramide monohydrochloride |
| L-Leucine 4-methoxy-Beta-naphthylamide Hydrochloride |
| N-(4-Methoxy-2-naphthyl)-L-leucinamide hydrochloride (1:1) |
| EINECS 224-735-3 |