pyridoxine 5'-phosphate structure
|
Common Name | pyridoxine 5'-phosphate | ||
|---|---|---|---|---|
| CAS Number | 447-05-2 | Molecular Weight | 249.15800 | |
| Density | 1.628g/cm3 | Boiling Point | 638.5ºC at 760mmHg | |
| Molecular Formula | C8H12NO6P | Melting Point | 123-126ºC | |
| MSDS | N/A | Flash Point | 340ºC | |
| Name | pyridoxine 5'-phosphate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.628g/cm3 |
|---|---|
| Boiling Point | 638.5ºC at 760mmHg |
| Melting Point | 123-126ºC |
| Molecular Formula | C8H12NO6P |
| Molecular Weight | 249.15800 |
| Flash Point | 340ºC |
| Exact Mass | 249.04000 |
| PSA | 129.92000 |
| LogP | 0.19720 |
| Vapour Pressure | 3.54E-17mmHg at 25°C |
| Index of Refraction | 1.625 |
| InChIKey | WHOMFKWHIQZTHY-UHFFFAOYSA-N |
| SMILES | Cc1ncc(COP(=O)(O)O)c(CO)c1O |
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATA
|
| HS Code | 2933399090 |
|---|
|
~%
pyridoxine 5'-p... CAS#:447-05-2 |
| Literature: Heyl et al. Journal of the American Chemical Society, 1951 , vol. 73, p. 3430,3432 |
|
~%
pyridoxine 5'-p... CAS#:447-05-2 |
| Literature: Huang, Shuohao; Zeng, Haibin; Zhang, Jianyun; Wei, Shu; Huang, Longquan Phytochemistry, 2011 , vol. 72, # 17 p. 2124 - 2129 |
|
~%
pyridoxine 5'-p... CAS#:447-05-2 |
| Literature: Morrison; Long Journal of the Chemical Society, 1958 , p. 211,214 |
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Pyridoxol,5-(dihydrogen phosphate) |
| Phosphorsaeure-mono-(5-hydroxy-4-hydroxymethyl-6-methyl-[3]pyridylmethylester) |
| phosphoric acid mono-(5-hydroxy-4-hydroxymethyl-6-methyl-[3]pyridylmethyl ester) |
| Pyridoxol 5-phosphate |
| Pyridoxyl-5-phosphate |
| [5-hydroxy-4-(hydroxymethyl)-6-methylpyridin-3-yl]methyl dihydrogen phosphate |
| Pyridoxine phosphate |
| pyridoxine-P |
| pyridoxine-5'-phosphate |