5.beta.-Chol-9 (11)-en-24-oic acid, 3.alpha.-hydroxy-12-oxo-, methyl ester, acetate structure
|
Common Name | 5.beta.-Chol-9 (11)-en-24-oic acid, 3.alpha.-hydroxy-12-oxo-, methyl ester, acetate | ||
|---|---|---|---|---|
| CAS Number | 4472-02-0 | Molecular Weight | 444.60400 | |
| Density | 1.12g/cm3 | Boiling Point | 531ºC at 760 mmHg | |
| Molecular Formula | C27H40O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 224.6ºC | |
| Name | 3|A,7|A-Dihydroxy-5|A-cholanic Acid Methyl Ester |
|---|---|
| Synonym | More Synonyms |
| Density | 1.12g/cm3 |
|---|---|
| Boiling Point | 531ºC at 760 mmHg |
| Molecular Formula | C27H40O5 |
| Molecular Weight | 444.60400 |
| Flash Point | 224.6ºC |
| Exact Mass | 444.28800 |
| PSA | 69.67000 |
| LogP | 5.26540 |
| Index of Refraction | 1.529 |
| InChIKey | XRLBQELEYBVDHJ-QHWYEGTESA-N |
| SMILES | COC(=O)CCC(C)C1CCC2C3CCC4CC(OC(C)=O)CCC4(C)C3=CC(=O)C12C |
| Methyl Ursodeoxycholate |
| Ursodeoxycholic Acid Methyl Ester |
| methyl ester of ursodeoxycholic acid |
| Methyl 3|A,7|A-Dihydroxy-5|A-cholanoate |