Chol-9(11)-en-24-oicacid, 3-hydroxy-12-oxo-, methyl ester, (3a,5b)- (9CI) structure
|
Common Name | Chol-9(11)-en-24-oicacid, 3-hydroxy-12-oxo-, methyl ester, (3a,5b)- (9CI) | ||
|---|---|---|---|---|
| CAS Number | 65065-56-7 | Molecular Weight | 402.56700 | |
| Density | 1.12g/cm3 | Boiling Point | 521.3ºC at 760mmHg | |
| Molecular Formula | C25H38O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 169.5ºC | |
| Name | methyl (4R)-4-[(3R,5R,8S,10S,13R,14S,17R)-3-hydroxy-10,13-dimethyl-12-oxo-1,2,3,4,5,6,7,8,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl]pentanoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.12g/cm3 |
|---|---|
| Boiling Point | 521.3ºC at 760mmHg |
| Molecular Formula | C25H38O4 |
| Molecular Weight | 402.56700 |
| Flash Point | 169.5ºC |
| Exact Mass | 402.27700 |
| PSA | 63.60000 |
| LogP | 4.69460 |
| Index of Refraction | 1.541 |
| InChIKey | OFUOIZWAZDUXAZ-WPYIARLMSA-N |
| SMILES | COC(=O)CCC(C)C1CCC2C3CCC4CC(O)CCC4(C)C3=CC(=O)C12C |
|
Name: NCI human tumor cell line growth inhibition assay. Data for the MCF7 Non-Small Cell L...
Source: DTP/NCI
Target: N/A
External Id: MCF7_OneDose
|
|
Name: NCI human tumor cell line growth inhibition assay. Data for the IGROV1 Non-Small Cell...
Source: DTP/NCI
Target: N/A
External Id: IGROV1_OneDose
|
| 2-phenoxyethyl 4-(2,3-dimethoxyphenyl)-7-(4-methoxyphenyl)-2-methyl-5-oxo-1,4,5,6,7,8-hexahydroquinoline-3-carboxylate |
| 2-phenoxyethyl 4-(2,3-dimethoxyphenyl)-7-(4-methoxyphenyl)-2-methyl-5-oxo-1,4,6,7,8-pentahydroquinoline-3-carboxylate |