dimethylformamide structure
|
Common Name | dimethylformamide | ||
|---|---|---|---|---|
| CAS Number | 4472-41-7 | Molecular Weight | 80.14 | |
| Density | 0.9±0.1 g/cm3 | Boiling Point | 153.0±0.0 °C at 760 mmHg | |
| Molecular Formula | C3H7NO | Melting Point | -61ºC | |
| MSDS | Chinese USA | Flash Point | 57.8±0.0 °C | |
| Symbol |
GHS02, GHS07, GHS08 |
Signal Word | Danger | |
| Name | N,N-Dimethylformamide-D7 |
|---|---|
| Synonym | More Synonyms |
| Density | 0.9±0.1 g/cm3 |
|---|---|
| Boiling Point | 153.0±0.0 °C at 760 mmHg |
| Melting Point | -61ºC |
| Molecular Formula | C3H7NO |
| Molecular Weight | 80.14 |
| Flash Point | 57.8±0.0 °C |
| Exact Mass | 80.096701068 |
| PSA | 20.31000 |
| LogP | -1.01 |
| Vapour Pressure | 3.4±0.2 mmHg at 25°C |
| Index of Refraction | 1.396 |
| InChIKey | ZMXDDKWLCZADIW-YYWVXINBSA-N |
| SMILES | [2H]C(=O)N(C([2H])([2H])[2H])C([2H])([2H])[2H] |
| Stability | Stable. Incompatible with strong oxidizing agents. Protect from moisture. |
| Symbol |
GHS02, GHS07, GHS08 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H226-H312 + H332-H319-H360 |
| Precautionary Statements | P201-P280-P305 + P351 + P338-P308 + P313 |
| Hazard Codes | T:Toxic; |
| Risk Phrases | R20/21;R36;R61 |
| Safety Phrases | S45-S53 |
| RIDADR | UN 2265 3 |
| WGK Germany | 2 |
| Packaging Group | III |
| Precursor 0 | |
|---|---|
| DownStream 3 | |
|
Mechanistic insight into the formation of cationic naked nanocrystals generated under equilibrium control.
J. Am. Chem. Soc. 136(44) , 15702-10, (2014) Cationic naked nanocrystals (NCs) are useful building units for assembling hierarchical mesostructured materials. Until now, their preparation required strongly electrophilic reagents that irreversibl... |
|
|
High-temperature in situ crystallographic observation of reversible gas sorption in impermeable organic cages.
Proc. Natl. Acad. Sci. U. S. A. 112 , 14156-61, (2015) Crystallographic observation of adsorbed gas molecules is a highly difficult task due to their rapid motion. Here, we report the in situ single-crystal and synchrotron powder X-ray observations of rev... |
|
|
trans-Platinum(II) complex of 3-aminoflavone - synthesis, X-ray crystal structure and biological activities in vitro.
Dalton Trans. 44(3) , 938-47, (2014) This paper describes the synthesis of trans-bis-(3-aminoflavone)dichloridoplatinum(ii) (trans-Pt(3-af)2Cl2; TCAP) for use as a potential anticancer compound, and the evaluation of its structure by ele... |
| DMF-d7, Heptadeutero-N,N-dimethylformamide |
| N,N'-DIMETHYLFORMAMIDE |
| N,N-dimethylmethanamide |
| dimethylformamide |
| N,N-Dimethylformamide [UN2265] [Flammable liquid] |
| EINECS 224-745-8 |
| N,N-Dimethyl formamide |
| MFCD00003286 |
| Dimethyl formamide |
| N,N-Dimethylformamide |
| DMF |
| Heptadeutero-N,N-dimethylformamide |
| N,N-Dimethylformamide-d7 |