3,5,6,7-tetramethoxy-2-(4-methoxyphenyl)chromen-4-one structure
|
Common Name | 3,5,6,7-tetramethoxy-2-(4-methoxyphenyl)chromen-4-one | ||
|---|---|---|---|---|
| CAS Number | 4472-73-5 | Molecular Weight | 372.36900 | |
| Density | 1.29g/cm3 | Boiling Point | 558.9ºC at 760 mmHg | |
| Molecular Formula | C20H20O7 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 245.6ºC | |
| Name | 3,5,6,7-tetramethoxy-2-(4-methoxyphenyl)chromen-4-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.29g/cm3 |
|---|---|
| Boiling Point | 558.9ºC at 760 mmHg |
| Molecular Formula | C20H20O7 |
| Molecular Weight | 372.36900 |
| Flash Point | 245.6ºC |
| Exact Mass | 372.12100 |
| PSA | 76.36000 |
| LogP | 3.50300 |
| Index of Refraction | 1.588 |
| InChIKey | OWNRDLYPIYHOQK-UHFFFAOYSA-N |
| SMILES | COc1ccc(-c2oc3cc(OC)c(OC)c(OC)c3c(=O)c2OC)cc1 |
| HS Code | 2914509090 |
|---|
| Precursor 10 | |
|---|---|
| DownStream 1 | |
| HS Code | 2914509090 |
|---|---|
| Summary | HS:2914509090 other ketones with other oxygen function VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| 6-hydroxykaempferol 3,5,6,7,4'-pentamethyl ether |
| 3,5,6,7,4'-pentamethoxyflavone |
| 3,4',5,6,7-PENTAMETHOXYFLAVONE |
| 3,5,6,7,4'-Pentamethoxy-flavon |