penduletin structure
|
Common Name | penduletin | ||
|---|---|---|---|---|
| CAS Number | 569-80-2 | Molecular Weight | 344.32 | |
| Density | 1.5±0.1 g/cm3 | Boiling Point | 595.1±50.0 °C at 760 mmHg | |
| Molecular Formula | C18H16O7 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 219.3±23.6 °C | |
Use of penduletinPenduletin is a flavone, that can be isolated from Brickelia pendula and Vitex negundo. Penduletin shows anticancer activity. Penduletin induces apoptosis in the cancer cells through ROS generation[1][2]. |
| Name | 5-hydroxy-2-(4-hydroxyphenyl)-3,6,7-trimethoxychromen-4-one |
|---|---|
| Synonym | More Synonyms |
| Description | Penduletin is a flavone, that can be isolated from Brickelia pendula and Vitex negundo. Penduletin shows anticancer activity. Penduletin induces apoptosis in the cancer cells through ROS generation[1][2]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.5±0.1 g/cm3 |
|---|---|
| Boiling Point | 595.1±50.0 °C at 760 mmHg |
| Molecular Formula | C18H16O7 |
| Molecular Weight | 344.32 |
| Flash Point | 219.3±23.6 °C |
| Exact Mass | 344.089600 |
| PSA | 98.36000 |
| LogP | 2.49 |
| Vapour Pressure | 0.0±1.7 mmHg at 25°C |
| Index of Refraction | 1.654 |
| InChIKey | YSXFFLGRZJWNFM-UHFFFAOYSA-N |
| SMILES | COc1cc2oc(-c3ccc(O)cc3)c(OC)c(=O)c2c(O)c1OC |
| Hazard Codes | Xi |
|---|
| Precursor 0 | |
|---|---|
| DownStream 1 | |
| 5,4'-Dihydroxy-3,6,7-trimethoxyflavone |
| 4H-1-Benzopyran-4-one, 5-hydroxy-2-(4-hydroxyphenyl)-3,6,7-trimethoxy- |
| 6-OH-kaempferol-3,6,7-trimethylether |
| 5-Hydroxy-2-(4-hydroxyphenyl)-3,6,7-trimethoxy-4H-1-benzopyran-4-one |
| Penduletin |
| 5-Hydroxy-2-(4-hydroxyphenyl)-3,6,7-trimethoxy-4H-chromen-4-one |
| 4',5-dihydroxy-3,6,7-trimethoxy-flavone |