N-Carbobenzyloxy-D-asparagine structure
|
Common Name | N-Carbobenzyloxy-D-asparagine | ||
|---|---|---|---|---|
| CAS Number | 4474-86-6 | Molecular Weight | 266.250 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 487.5±55.0 °C at 760 mmHg | |
| Molecular Formula | C12H14N2O5 | Melting Point | 162-164ºC | |
| MSDS | N/A | Flash Point | 248.6±31.5 °C | |
| Name | Nα-Carbobenzoxy-D-asparagine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 487.5±55.0 °C at 760 mmHg |
| Melting Point | 162-164ºC |
| Molecular Formula | C12H14N2O5 |
| Molecular Weight | 266.250 |
| Flash Point | 248.6±31.5 °C |
| Exact Mass | 266.090271 |
| PSA | 118.72000 |
| LogP | 1.62 |
| Vapour Pressure | 0.0±1.3 mmHg at 25°C |
| Index of Refraction | 1.584 |
| InChIKey | FUCKRCGERFLLHP-SECBINFHSA-N |
| SMILES | NC(=O)CC(NC(=O)OCc1ccccc1)C(=O)O |
| Storage condition | Store at RT. |
| WGK Germany | 3 |
|---|---|
| HS Code | 2924299090 |
|
~%
N-Carbobenzylox... CAS#:4474-86-6 |
| Literature: E. R. Squibb and Sons, Inc. Patent: US642 H1, 1989 ; |
|
~%
N-Carbobenzylox... CAS#:4474-86-6 |
| Literature: Okamoto, Yoshio; Aburatani, Ryo; Kaida, Yuriko; Hatada, Koichi Chemistry Letters, 1988 , p. 1125 - 1128 |
|
~%
N-Carbobenzylox... CAS#:4474-86-6 |
| Literature: Zhang, Zhenyu; Aerschot, Arthur Van; Hendrix, Chris; Busson, Roger; David, Frank; Sandra, Pat; Herdewijn, Piet Tetrahedron, 2000 , vol. 56, # 16 p. 2513 - 2522 |
|
~%
N-Carbobenzylox... CAS#:4474-86-6 |
| Literature: Berlingozzi et al. Gazzetta Chimica Italiana, 1958 , vol. 88, p. 9,12 |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| D-Asparagine, N-[(phenylmethoxy)carbonyl]- |
| (2S)-4-Amino-2-{[(benzyloxy)carbonyl]amino}-4-oxobutanoic acid |
| D-Homoserine, N-[hydroxy(phenylmethoxy)methylene]-4-imino-, (E)- |
| Nα-Cbz-D-asparagine |
| MFCD00065696 |
| N-[(Benzyloxy)carbonyl]-D-asparagine |
| Cbz-D-Asn-OH |
| N-Cbz-D-Asparagine |
| L-Asparagine, N2-[(phenylmethoxy)carbonyl]- |
| L-Asparagine, N-[(phenylmethoxy)carbonyl]- |
| Carbobenzyloxy-L-asparagine |
| Carbobenzoxy-L-asparagine |
| Nα-Carbobenzoxy-D-asparagine |
| N-[(Benzyloxy)carbonyl]-L-asparagine |
| N2-[(Phenylmehtoxy)carbonyl]-L-asparagine |
| (E)-N-[(Benzyloxy)(hydroxy)methylene]-4-imino-D-homoserine |
| (2R)-4-amino-4-oxo-2-(phenylmethoxycarbonylamino)butanoic acid |
| Benzyloxycarbonyl-D-asparagine |
| N-Carbobenzyloxy-D-asparagine |