2-(4-(Trifluoromethyl)phenyl)thiazole-5-carbaldehyde structure
|
Common Name | 2-(4-(Trifluoromethyl)phenyl)thiazole-5-carbaldehyde | ||
|---|---|---|---|---|
| CAS Number | 447406-52-2 | Molecular Weight | 257.23200 | |
| Density | 1.408g/cm3 | Boiling Point | 346ºC at 760 mmHg | |
| Molecular Formula | C11H6F3NOS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 163ºC | |
| Name | 2-(4-Trifluoromethylphenyl)thiazole-5-carbaldehyde |
|---|---|
| Synonym | More Synonyms |
| Density | 1.408g/cm3 |
|---|---|
| Boiling Point | 346ºC at 760 mmHg |
| Molecular Formula | C11H6F3NOS |
| Molecular Weight | 257.23200 |
| Flash Point | 163ºC |
| Exact Mass | 257.01200 |
| PSA | 58.20000 |
| LogP | 3.64140 |
| Index of Refraction | 1.56 |
| InChIKey | ULPFTKOKWHCIQH-UHFFFAOYSA-N |
| SMILES | O=Cc1cnc(-c2ccc(C(F)(F)F)cc2)s1 |
| HS Code | 2934100090 |
|---|
|
~20%
2-(4-(Trifluoro... CAS#:447406-52-2 |
| Literature: US2007/244094 A1, ; Page/Page column 51-52 ; |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2934100090 |
|---|---|
| Summary | 2934100090 other compounds containing an unfused thiazole ring (whether or not hydrogenated) in the structure VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
| 2-[4-(trifluoromethyl)phenyl]-1,3-thiazole-5-carbaldehyde |