2-(3-oxo-1,3-diphenyl-propyl)propanedioic acid structure
|
Common Name | 2-(3-oxo-1,3-diphenyl-propyl)propanedioic acid | ||
|---|---|---|---|---|
| CAS Number | 4475-13-2 | Molecular Weight | 312.31700 | |
| Density | 1.311g/cm3 | Boiling Point | 567.4ºC at 760 mmHg | |
| Molecular Formula | C18H16O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 311ºC | |
| Name | 2-(3-oxo-1,3-diphenylpropyl)propanedioic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.311g/cm3 |
|---|---|
| Boiling Point | 567.4ºC at 760 mmHg |
| Molecular Formula | C18H16O5 |
| Molecular Weight | 312.31700 |
| Flash Point | 311ºC |
| Exact Mass | 312.10000 |
| PSA | 91.67000 |
| LogP | 2.82860 |
| Index of Refraction | 1.608 |
| InChIKey | HHCMOYAXJFBXPH-UHFFFAOYSA-N |
| SMILES | O=C(CC(c1ccccc1)C(C(=O)O)C(=O)O)c1ccccc1 |
| HS Code | 2918300090 |
|---|
|
~%
2-(3-oxo-1,3-di... CAS#:4475-13-2 |
| Literature: Michael; Ross Journal of the American Chemical Society, 1933 , vol. 55, p. 1632,1644 |
|
~%
2-(3-oxo-1,3-di... CAS#:4475-13-2 |
| Literature: Rao, H. Surya Prakash; Bharathi, B. Journal of Chemical Research, Miniprint, 1994 , # 3 p. 541 - 554 |
|
~%
2-(3-oxo-1,3-di... CAS#:4475-13-2 |
| Literature: Vorlaender; Knoetzsch Justus Liebigs Annalen der Chemie, 1897 , vol. 294, p. 332 |
| HS Code | 2918300090 |
|---|---|
| Summary | 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| (3-oxo-1,3-diphenyl-propyl)-malonic acid |
| (3-Oxo-1,3-diphenyl-propyl)-malonsaeure |
| 2-Phenyl-3-benzoyl-propan-dicarbonsaeure-(1.1) |
| 4-Oxo-2.4-diphenyl-butan-dicarbonsaeure-(1.1) |