2-[4-(4-methoxyphenyl)piperazin-1-yl]ethyl (E)-3-pyridin-3-ylprop-2-enoate structure
|
Common Name | 2-[4-(4-methoxyphenyl)piperazin-1-yl]ethyl (E)-3-pyridin-3-ylprop-2-enoate | ||
|---|---|---|---|---|
| CAS Number | 4480-22-2 | Molecular Weight | 367.44200 | |
| Density | 1.174g/cm3 | Boiling Point | 555.5ºC at 760 mmHg | |
| Molecular Formula | C21H25N3O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 289.7ºC | |
| Name | 2-[4-(4-methoxyphenyl)piperazin-1-yl]ethyl (E)-3-pyridin-3-ylprop-2-enoate |
|---|
| Density | 1.174g/cm3 |
|---|---|
| Boiling Point | 555.5ºC at 760 mmHg |
| Molecular Formula | C21H25N3O3 |
| Molecular Weight | 367.44200 |
| Flash Point | 289.7ºC |
| Exact Mass | 367.19000 |
| PSA | 54.90000 |
| LogP | 2.47170 |
| Index of Refraction | 1.592 |
| InChIKey | GLFWZGIFACHXKU-RUDMXATFSA-N |
| SMILES | COc1ccc(N2CCN(CCOC(=O)C=Cc3cccnc3)CC2)cc1 |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |