1-Nitro-4-nitrosobenzene
1-Nitro-4-nitrosobenzene structure
|
Common Name | 1-Nitro-4-nitrosobenzene | ||
|---|---|---|---|---|
| CAS Number | 4485-08-9 | Molecular Weight | 152.10800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C6H4N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1-Nitro-4-nitrosobenzene |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C6H4N2O3 |
|---|---|
| Molecular Weight | 152.10800 |
| Exact Mass | 152.02200 |
| PSA | 75.25000 |
| LogP | 2.51590 |
| InChIKey | IDZTUECABAHWLE-UHFFFAOYSA-N |
| SMILES | O=Nc1ccc([N+](=O)[O-])cc1 |
This table covers safety warnings, protective measures, incompatible substances and disposal guidelines for this compound.
| HS Code | 2904209090 |
|---|
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 0 | |
|---|---|
| DownStream 8 | |
CAS#:2491-52-3
CAS#:100-15-2
CAS#:100-25-4
CAS#:1047663-42-2
CAS#:3646-57-9
CAS#:614-25-5
CAS#:1516-60-5
CAS#:51788-98-8This table shows customs‑related data including HS‑code, tariff and regulatory conditions for import and export.
| HS Code | 2904209090 |
|---|---|
| Summary | 2904209090 derivatives containing only nitro or only nitroso groups。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:5.5%。General tariff:30.0% |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of 1-Nitro-4-nitrosobenzene? |
| A: InChIKey of 1-Nitro-4-nitrosobenzene is IDZTUECABAHWLE-UHFFFAOYSA-N. |
| Q: What is the SMILES notation of 1-Nitro-4-nitrosobenzene? |
| A: SMILES notation of 1-Nitro-4-nitrosobenzene is O=Nc1ccc([N+](=O)[O-])cc1. |
| Q: What is the molecular formula of 1-Nitro-4-nitrosobenzene? |
| A: Molecular formula of 1-Nitro-4-nitrosobenzene is C6H4N2O3. |
| Q: What is the molecular weight of 1-Nitro-4-nitrosobenzene? |
| A: Molecular weight of 1-Nitro-4-nitrosobenzene is 152.10800. |
| Q: What is the CAS number of 1-Nitro-4-nitrosobenzene? |
| A: CAS number of 1-Nitro-4-nitrosobenzene is 4485-08-9. |
| Q: What are the downstream products of 1-Nitro-4-nitrosobenzene? |
| A: Related downstream products(CAS) of 1-Nitro-4-nitrosobenzene: 2491-52-3;100-15-2;100-25-4;1047663-42-2;3646-57-9;614-25-5;1516-60-5;51788-98-8. |
| Q: What is the Chinese name of 4485-08-9? |
| A: Chinese name of 4485-08-9 is 4485-08-9. |
| Q: What is the LogP of 1-Nitro-4-nitrosobenzene? |
| A: LogP of 1-Nitro-4-nitrosobenzene is 2.51590. |
| Q: What is the polar surface area (PSA) of 1-Nitro-4-nitrosobenzene? |
| A: Polar surface area (PSA) of 1-Nitro-4-nitrosobenzene is 75.25000. |
| Q: What is the English name of 1-Nitro-4-nitrosobenzene? |
| A: The English name of 1-Nitro-4-nitrosobenzene is 1-Nitro-4-nitrosobenzene. |