4-Nitropyridin-2-ol
Modify Date: 2025-08-27 18:07:37
4-Nitropyridin-2-ol structure
|
Common Name | 4-Nitropyridin-2-ol | ||
|---|---|---|---|---|
| CAS Number | 4487-51-8 | Molecular Weight | 140.097 | |
| Density | 1.5±0.1 g/cm3 | Boiling Point | 407.8±30.0 °C at 760 mmHg | |
| Molecular Formula | C5H4N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 200.4±24.6 °C | |
| Name | 4-Nitropyridin-2-ol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.5±0.1 g/cm3 |
|---|---|
| Boiling Point | 407.8±30.0 °C at 760 mmHg |
| Molecular Formula | C5H4N2O3 |
| Molecular Weight | 140.097 |
| Flash Point | 200.4±24.6 °C |
| Exact Mass | 140.022186 |
| PSA | 78.94000 |
| LogP | -0.33 |
| Vapour Pressure | 0.0±1.0 mmHg at 25°C |
| Index of Refraction | 1.623 |
| InChIKey | STJAXIFXCBWILG-UHFFFAOYSA-N |
| SMILES | O=c1cc([N+](=O)[O-])cc[nH]1 |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2933399090 |
| Precursor 0 | |
|---|---|
| DownStream 3 | |
CAS#:32896-90-5
CAS#:18614-54-5
CAS#:1194041-65-0| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 4-Nitro-2(1H)-pyridinone |
| 4-nitro-1H-pyridin-2-one |
| MFCD04114149 |
| 2(1H)-Pyridinone, 4-nitro- |
| 4-Nitropyridin-2-ol |
| 2-Hydroxy-4-nitropyridine |