2,4-DIBROMO-5-NITROPYRIDINE structure
|
Common Name | 2,4-DIBROMO-5-NITROPYRIDINE | ||
|---|---|---|---|---|
| CAS Number | 4487-57-4 | Molecular Weight | 281.890 | |
| Density | 2.2±0.1 g/cm3 | Boiling Point | 292.0±35.0 °C at 760 mmHg | |
| Molecular Formula | C5H2Br2N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 130.4±25.9 °C | |
| Name | 2,4-Dibromo-5-nitropyridine |
|---|---|
| Synonym | More Synonyms |
| Density | 2.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 292.0±35.0 °C at 760 mmHg |
| Molecular Formula | C5H2Br2N2O2 |
| Molecular Weight | 281.890 |
| Flash Point | 130.4±25.9 °C |
| Exact Mass | 279.848297 |
| PSA | 58.71000 |
| LogP | 1.77 |
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |
| Index of Refraction | 1.650 |
| InChIKey | RZZGFCFQBVRQSX-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1cnc(Br)cc1Br |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2933399090 |
|
~75%
2,4-DIBROMO-5-N... CAS#:4487-57-4 |
| Literature: GLAXO GROUP LIMITED Patent: WO2005/37197 A2, 2005 ; Location in patent: Page/Page column 94 ; WO 2005/037197 A2 |
|
~%
2,4-DIBROMO-5-N... CAS#:4487-57-4 |
| Literature: GALAPAGOS NV; MENET, Christel Jeanne Marie; SCHMITT, Benoît Antoine; GENEY, Raphaël Jean Joël; DOYLE, Kevin James; PEACH, Joanne; PALMER, Nicholas John; JONES, Graham Peter; HARDY, David; DUFFY, James Edward Stewart Patent: WO2013/117645 A1, 2013 ; Location in patent: Paragraph 00543 ; |
|
~%
2,4-DIBROMO-5-N... CAS#:4487-57-4 |
| Literature: PHARMACOPEIA, INC. Patent: WO2009/62059 A2, 2009 ; Location in patent: Page/Page column 32 ; WO 2009/062059 A2 |
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2,4-DIBROMO-5-NITROPYRIDINE |
| 2,4-dibromo-5-nitro-pyridine |
| 2,4-bis(bromanyl)-5-nitro-pyridine |
| Pyridine,2,4-dibromo-5-nitro |
| T6NJ BE DE ENW |
| 2,4-Dibrom-5-nitro-pyridin |