(1R-trans)-2,2-dimethyl-3-(2-methylprop-1-enyl)cyclopropanecarbonyl chloride structure
|
Common Name | (1R-trans)-2,2-dimethyl-3-(2-methylprop-1-enyl)cyclopropanecarbonyl chloride | ||
|---|---|---|---|---|
| CAS Number | 4489-14-9 | Molecular Weight | 186.67800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H15ClO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2,2-dimethyl-3R-(2'-methyl-1'-propenyl)-cyclopropane-1R-carboxylic acid chloride |
|---|
| Molecular Formula | C10H15ClO |
|---|---|
| Molecular Weight | 186.67800 |
| Exact Mass | 186.08100 |
| PSA | 17.07000 |
| LogP | 2.99020 |
| InChIKey | VNTCVNLNEOVBEE-SFYZADRCSA-N |
| SMILES | CC(C)=CC1C(C(=O)Cl)C1(C)C |
| HS Code | 2916209090 |
|---|
| Precursor 0 | |
|---|---|
| DownStream 2 | |
| HS Code | 2916209090 |
|---|---|
| Summary | 2916209090 other cyclanic, cyclenic or cyclotherpenic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:6.5% General tariff:30.0% |