Dimefluthrin structure
|
Common Name | Dimefluthrin | ||
|---|---|---|---|---|
| CAS Number | 271241-14-6 | Molecular Weight | 748.74000 | |
| Density | 1.255 g/cm3 | Boiling Point | 352.4ºC at 760 mmHg | |
| Molecular Formula | C38H44F8O6 | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | 161.4ºC | |
| Name | dimefluthrin |
|---|---|
| Synonym | More Synonyms |
| Density | 1.255 g/cm3 |
|---|---|
| Boiling Point | 352.4ºC at 760 mmHg |
| Molecular Formula | C38H44F8O6 |
| Molecular Weight | 748.74000 |
| Flash Point | 161.4ºC |
| Exact Mass | 748.30100 |
| PSA | 71.06000 |
| LogP | 9.34200 |
| Vapour Pressure | 3.84E-05mmHg at 25°C |
| Index of Refraction | 1.516 |
| InChIKey | OOWCJRMYMAMSOH-UHFFFAOYSA-N |
| SMILES | COCc1c(F)c(F)c(COC(=O)C2C(C=C(C)C)C2(C)C)c(F)c1F |
| Storage condition | 2-8°C |
| Hazard Statements | H413 |
|---|---|
| RIDADR | NONH for all modes of transport |
| HS Code | 2916209026 |
| HS Code | 2916209026 |
|---|---|
| Summary | 2916209026. VAT:17.0%. Tax rebate rate:9.0%. Supervision conditions:S(import or export registration certificate for pesticides). MFN tariff:6.5%. General tariff:30.0% |
|
Pyrethroids in indoor air during application of various mosquito repellents: Occurrence, dissipation and potential exposure risk.
Chemosphere 144 , 2427-35, (2015) Commercial mosquito repellents (MRs) are generally applied as mosquito coils, electric vaporizers (liquid and solid) or aerosol spray, with pyrethroids often being the active ingredients. Four types o... |
| [2,3,5,6-tetrafluoro-4-(methoxymethyl)phenyl]methyl 2,2-dimethyl-3-(2-methylprop-1-enyl)cyclopropane-1-carboxylate |
| [2,3,5,6-tetrafluoro-4-(methoxymethyl)phenyl]methyl (1Ξ,3Ξ)-2,2-dimethyl-3-(2-methylprop-1-en-1-yl)cyclopropane-1-carboxylate |
| [2,3,5,6-tetrafluoro-4-(methoxymethyl)phenyl]methyl 2,2-dimethyl-3-(2-methyl-1-propen-1-yl)cyclopropanecarboxylate |
| 2,3,5,6-Tetrafluoro-4-(methoxymethyl)benzyl,1RS,3RS |
| 1RS,3SR)-2,2-dimethyl-3-(2-methylprop-1-enyl)cyclopropanecarboxylate |
| 1RS,3SR)-2,2-dimethyl-3-(2-methylprop-1-enyl)cyclopropanecarboxylate |
| Dimefluthrin |
| 2,3,5,6-tetrafluoro-4-(methoxymethyl)benzyl (1RS)-cis,trans-2,2-dimethyl-3-(2-methylprop-1-enyl)cyclopropanecarboxylate |
| 2,3,5,6-tetrafluoro-4-(methoxymethyl)benzyl (1RS,3RS |