4,6-Dichloro-2-methylsulfonylpyrimidine structure
|
Common Name | 4,6-Dichloro-2-methylsulfonylpyrimidine | ||
|---|---|---|---|---|
| CAS Number | 4489-34-3 | Molecular Weight | 227.068 | |
| Density | 1.6±0.1 g/cm3 | Boiling Point | 402.3±48.0 °C at 760 mmHg | |
| Molecular Formula | C5H4Cl2N2O2S | Melting Point | 117-118°C | |
| MSDS | Chinese USA | Flash Point | 197.1±29.6 °C | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 4,6-Dichloro-2-(methylsulfonyl)pyrimidine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.6±0.1 g/cm3 |
|---|---|
| Boiling Point | 402.3±48.0 °C at 760 mmHg |
| Melting Point | 117-118°C |
| Molecular Formula | C5H4Cl2N2O2S |
| Molecular Weight | 227.068 |
| Flash Point | 197.1±29.6 °C |
| Exact Mass | 225.937057 |
| PSA | 68.30000 |
| LogP | 0.30 |
| Vapour Pressure | 0.0±0.9 mmHg at 25°C |
| Index of Refraction | 1.555 |
| InChIKey | DROUVIKCNOHKBA-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)c1nc(Cl)cc(Cl)n1 |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H302-H319 |
| Precautionary Statements | P305 + P351 + P338 |
| Hazard Codes | Xn |
| Risk Phrases | R52/53:Harmful to aquatic organisms, may cause long-term adverse effects in the aquatic environment . |
| Safety Phrases | S61 |
| RIDADR | NONH for all modes of transport |
| HS Code | 2933599090 |
| Precursor 0 | |
|---|---|
| DownStream 9 | |
| HS Code | 2933599090 |
|---|---|
| Summary | 2933599090. other compounds containing a pyrimidine ring (whether or not hydrogenated) or piperazine ring in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 4,6-Dichloro-2-(methylsulfonyl)pyrimidine |
| 4,6-dichloro-2-methylsulfonylpyrimidine |
| 4,6-Dichloro-2-(methanesulfonyl)pyrimidine |
| Pyrimidine, 4,6-dichloro-2-(methylsulfonyl)- |
| MFCD03788286 |