(2-aminophenyl)-(4-fluorophenyl)methanone,methanesulfonic acid structure
|
Common Name | (2-aminophenyl)-(4-fluorophenyl)methanone,methanesulfonic acid | ||
|---|---|---|---|---|
| CAS Number | 449181-32-2 | Molecular Weight | 311.32900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H14FNO4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | (2-aminophenyl)-(4-fluorophenyl)methanone,methanesulfonic acid |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C14H14FNO4S |
|---|---|
| Molecular Weight | 311.32900 |
| Exact Mass | 311.06300 |
| PSA | 105.84000 |
| LogP | 3.80490 |
| InChIKey | NTRZJJUYWMYMHI-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)O.Nc1ccccc1C(=O)c1ccc(F)cc1 |
| HS Code | 2922399090 |
|---|
| HS Code | 2922399090 |
|---|---|
| Summary | 2922399090 other amino-aldehydes, amino-ketones and amino-quinones, other than those containing more than one kind of oxygen function; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| 2-amino-4'-fluorobenzophenone methanesulfonate |