Sodium 2-hydroxyquinolin-4-olate structure
|
Common Name | Sodium 2-hydroxyquinolin-4-olate | ||
|---|---|---|---|---|
| CAS Number | 4510-76-3 | Molecular Weight | 183.139 | |
| Density | N/A | Boiling Point | 303.8ºC at 760 mmHg | |
| Molecular Formula | C9H6NNaO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 137.5ºC | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 2,4-dihydroxyquinoline monosodium salt |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 303.8ºC at 760 mmHg |
|---|---|
| Molecular Formula | C9H6NNaO2 |
| Molecular Weight | 183.139 |
| Flash Point | 137.5ºC |
| Exact Mass | 183.029617 |
| PSA | 56.18000 |
| LogP | 2.08420 |
| InChIKey | MWXMDMIYCCSYNP-UHFFFAOYSA-M |
| SMILES | O=c1cc([O-])c2ccccc2[nH]1.[Na+] |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H302 + H312 + H332-H315-H319-H335 |
| Precautionary Statements | P261-P280-P305 + P351 + P338 |
| Hazard Codes | Xn |
| Risk Phrases | 20/21/22-36/37/38-40 |
| Safety Phrases | S26-S27-S36/37/39 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 2933499090 |
| HS Code | 2933499090 |
|---|---|
| Summary | 2933499090. other compounds containing in the structure a quinoline or isoquinoline ring-system (whether or not hydrogenated), not further fused. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
|
Synthesis and investigations of the absorption spectra of hetarylazo disperse dyes derived from 2, 4-quinolinediol. Sener L, et al.
Dyes and Pigments 70(2) , 143-148, (2006)
|
| MFCD00064371 |
| 2,4-quinolinediol monosodium salt |
| 2,4-QUINOLINEDIOL,MONOSODIUM SALT HYDRA TE,TECH. |
| 2,4-Quinolinediol hydrate monosodium salt |
| 2,4-quinolinediol, sodium salt (1:1) |
| 4(1H)-Quinolinone, 2-hydroxy-, sodium salt (1:1) |
| Sodium 2-hydroxyquinolin-4-olate |
| 4-hydroxy-2-quinolone,monosodium salt |
| Sodium 4-oxo-1,4-dihydro-2-quinolinolate |
| 4-hydroxy-2-quinolone |
| EINECS 224-828-9 |
| 2,4-Dihydroxyquinoline Monosodium Salt Hydrate |
| 2,4-Dioxyquinoline monosodium salt |