methyl 4-prop-2-enoyloxybenzoate structure
|
Common Name | methyl 4-prop-2-enoyloxybenzoate | ||
|---|---|---|---|---|
| CAS Number | 4513-48-8 | Molecular Weight | 206.19500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H10O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | methyl 4-prop-2-enoyloxybenzoate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C11H10O4 |
|---|---|
| Molecular Weight | 206.19500 |
| Exact Mass | 206.05800 |
| PSA | 52.60000 |
| LogP | 1.56460 |
| InChIKey | WMJVAKULPHVQAB-UHFFFAOYSA-N |
| SMILES | C=CC(=O)Oc1ccc(C(=O)OC)cc1 |
| HS Code | 2918990090 |
|---|
|
~%
methyl 4-prop-2... CAS#:4513-48-8 |
| Literature: Fort, Yves; Berthe, Marie Christine; Caubere, Paul Tetrahedron, 1992 , vol. 48, # 31 p. 6371 - 6384 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 4-acryloyloxy benzoic acid methyl ester |