ethyl pentafluorobenzoate structure
|
Common Name | ethyl pentafluorobenzoate | ||
|---|---|---|---|---|
| CAS Number | 4522-93-4 | Molecular Weight | 240.12700 | |
| Density | 1.431 g/mL at 25 °C(lit.) | Boiling Point | 113 °C(lit.) | |
| Molecular Formula | C9H5F5O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 177 °F | |
| Name | ethyl pentafluorobenzoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.431 g/mL at 25 °C(lit.) |
|---|---|
| Boiling Point | 113 °C(lit.) |
| Molecular Formula | C9H5F5O2 |
| Molecular Weight | 240.12700 |
| Flash Point | 177 °F |
| Exact Mass | 240.02100 |
| PSA | 26.30000 |
| LogP | 2.55880 |
| Index of Refraction | n20/D 1.428(lit.) |
| InChIKey | DFUDMSIRGGTHGI-UHFFFAOYSA-N |
| SMILES | CCOC(=O)c1c(F)c(F)c(F)c(F)c1F |
| HS Code | 2916399090 |
|---|---|
| Summary | 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| EINECS 224-854-0 |
| Ethyl 2,3,4,5,6-pentafluorobenzoate |
| Ethyl Pentafluorobenzoate |
| MFCD00039211 |
| Pentafluorobenzoic Acid Ethyl Ester |
| Ethyl Perfluorobenzoate |
| Perfluorobenzoic Acid Ethyl Ester |