1,4-BIS(TRIMETHYLSILYL)-1,3-BUTADIYNE structure
|
Common Name | 1,4-BIS(TRIMETHYLSILYL)-1,3-BUTADIYNE | ||
|---|---|---|---|---|
| CAS Number | 4526-07-2 | Molecular Weight | 194.421 | |
| Density | 0.8±0.1 g/cm3 | Boiling Point | 197.7±23.0 °C at 760 mmHg | |
| Molecular Formula | C10H18Si2 | Melting Point | 111-113 °C(lit.) | |
| MSDS | N/A | Flash Point | 57.3±15.6 °C | |
| Name | 1,4-Bis(Trimethylsilyl)-1,3-Butadiyne |
|---|---|
| Synonym | More Synonyms |
| Density | 0.8±0.1 g/cm3 |
|---|---|
| Boiling Point | 197.7±23.0 °C at 760 mmHg |
| Melting Point | 111-113 °C(lit.) |
| Molecular Formula | C10H18Si2 |
| Molecular Weight | 194.421 |
| Flash Point | 57.3±15.6 °C |
| Exact Mass | 194.094696 |
| LogP | 5.57 |
| Vapour Pressure | 0.5±0.4 mmHg at 25°C |
| Index of Refraction | 1.446 |
| InChIKey | LBNVCJHJRYJVPK-UHFFFAOYSA-N |
| SMILES | C[Si](C)(C)C#CC#C[Si](C)(C)C |
| Storage condition | 0-6°C |
| Hazard Codes | F: Flammable; |
|---|---|
| Risk Phrases | R11 |
| Safety Phrases | S16-S22-S24/25 |
| RIDADR | UN 1325 4.1/PG 2 |
| WGK Germany | 3 |
| Packaging Group | II |
| Hazard Class | 4.1 |
| HS Code | 2931900090 |
| Precursor 9 | |
|---|---|
| DownStream 10 | |
| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |
| 1,3-Butadiyne-1,4-diylbis(trimethylsilane) |
| 1,4-Bis(trimethylsilyl)butadiyne |
| 1,4-Bis(trimethylsilyl)-1,3-butadiyne,BTMSBD |
| 1,4-BIS(TRIMETHYLSILYL)-1,3-BUTADIYNE |
| Buta-1,3-diyne-1,4-diylbis(trimethylsilane) |
| MFCD00009839 |
| Silane, 1,1'-(1,3-butadiyne-1,4-diyl)bis[1,1,1-trimethyl- |
| 1,4-Bis(trimethylsilyl)buta-1,3-diyne |
| trimethyl(4-trimethylsilylbuta-1,3-diynyl)silane |