2-(Bromomethyl)-1-fluoro-4-nitrobenzene structure
|
Common Name | 2-(Bromomethyl)-1-fluoro-4-nitrobenzene | ||
|---|---|---|---|---|
| CAS Number | 454-15-9 | Molecular Weight | 234.023 | |
| Density | 1.7±0.1 g/cm3 | Boiling Point | 303.4±27.0 °C at 760 mmHg | |
| Molecular Formula | C7H5BrFNO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 137.3±23.7 °C | |
| Name | 2-(Bromomethyl)-1-fluoro-4-nitrobenzene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.7±0.1 g/cm3 |
|---|---|
| Boiling Point | 303.4±27.0 °C at 760 mmHg |
| Molecular Formula | C7H5BrFNO2 |
| Molecular Weight | 234.023 |
| Flash Point | 137.3±23.7 °C |
| Exact Mass | 232.948761 |
| PSA | 45.82000 |
| LogP | 2.50 |
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |
| Index of Refraction | 1.588 |
| InChIKey | KQAKOKGCKNKARC-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1ccc(F)c(CBr)c1 |
| HS Code | 2904909090 |
|---|
|
~10%
2-(Bromomethyl)... CAS#:454-15-9 |
| Literature: BAYER INTELLECTUAL PROPERTY GMBH; Krüger, Joachim; Grossbach, Danja; Paulsen, Holger; Kroh, Walter Patent: US2013/116443 A1, 2013 ; Location in patent: Paragraph 0117; 0118 ; |
|
~73%
2-(Bromomethyl)... CAS#:454-15-9 |
| Literature: O'Neill, Paul M.; Harrison, Anthony C.; Storr, Richard C.; Hawley, Shaun R.; Ward, Stephen A.; Park, B. Kevin Journal of Medicinal Chemistry, 1994 , vol. 37, # 9 p. 1362 - 1370 |
|
~%
2-(Bromomethyl)... CAS#:454-15-9 |
| Literature: BAYER SCHERING PHARMA AKTIENGESELLSCHAFT Patent: US2010/261759 A1, 2010 ; US 20100261759 A1 |
|
~%
2-(Bromomethyl)... CAS#:454-15-9 |
| Literature: Sveinbjornsson; VanderWerf Journal of the American Chemical Society, 1951 , vol. 73, p. 1378 |
| HS Code | 2904909090 |
|---|---|
| Summary | HS:2904909090 sulphonated, nitrated or nitrosated derivatives of hydrocarbons, whether or not halogenated VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| 4-fluoro-3-bromomethylnitrobenzene |
| 2-bromomethyl-1-fluoro-4-nitro-benzene |
| 2-Fluoro-5-nitrobenzyl bromide |
| 2-Fluor-5-nitro-benzylbromid |
| 3-BROMOMETHYL-4-FLUORONITROBENZENE |
| 2-(Bromomethyl)-1-fluoro-4-nitrobenzene |
| Benzene, 2-(bromomethyl)-1-fluoro-4-nitro- |