methyl 2-phenylquinoline-4-carboxylate structure
|
Common Name | methyl 2-phenylquinoline-4-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 4546-48-9 | Molecular Weight | 263.29100 | |
| Density | 1.197g/cm3 | Boiling Point | 430.8ºC at 760 mmHg | |
| Molecular Formula | C17H13NO2 | Melting Point | 60-62ºC(lit.) | |
| MSDS | Chinese USA | Flash Point | 214.4ºC | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | methyl 2-phenylquinoline-4-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.197g/cm3 |
|---|---|
| Boiling Point | 430.8ºC at 760 mmHg |
| Melting Point | 60-62ºC(lit.) |
| Molecular Formula | C17H13NO2 |
| Molecular Weight | 263.29100 |
| Flash Point | 214.4ºC |
| Exact Mass | 263.09500 |
| PSA | 39.19000 |
| LogP | 3.68840 |
| Index of Refraction | 1.632 |
| InChIKey | FDNMMBMNYRTPLC-UHFFFAOYSA-N |
| SMILES | COC(=O)c1cc(-c2ccccc2)nc2ccccc12 |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi |
| Risk Phrases | 36/37/38 |
| Safety Phrases | 26-37/39 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 2933499090 |
| Precursor 8 | |
|---|---|
| DownStream 2 | |
| HS Code | 2933499090 |
|---|---|
| Summary | 2933499090. other compounds containing in the structure a quinoline or isoquinoline ring-system (whether or not hydrogenated), not further fused. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Methyl 2-phenyl-4-quinolinecarboxylate |
| MFCD00006749 |
| Cinchophen methyl derivative |
| 2-Phenyl-quinoline-4-carboxylic acid methyl ester |
| 2-phenyl-4-(methoxycarbonyl)quinoline |
| 2-phenyl-4-(methylcarboxylate)quinoline |
| 4-methoxycarbonyl-2-phenylquinoline |
| 2-phenyl-4-quinolinecarboxylic acid methyl ester |
| 4-Quinolinecarboxylic acid,2-phenyl-,methyl ester |