tert-butyl 3-amino-4-hydroxypiperidine-1-carboxylate structure
|
Common Name | tert-butyl 3-amino-4-hydroxypiperidine-1-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 454709-92-3 | Molecular Weight | 216.277 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 326.1±42.0 °C at 760 mmHg | |
| Molecular Formula | C10H20N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 151.0±27.9 °C | |
| Name | tert-butyl 3-amino-4-hydroxypiperidine-1-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 326.1±42.0 °C at 760 mmHg |
| Molecular Formula | C10H20N2O3 |
| Molecular Weight | 216.277 |
| Flash Point | 151.0±27.9 °C |
| Exact Mass | 216.147400 |
| PSA | 75.79000 |
| LogP | -0.25 |
| Vapour Pressure | 0.0±1.6 mmHg at 25°C |
| Index of Refraction | 1.510 |
| InChIKey | LUQURLQDYAJECW-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC(O)C(N)C1 |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2933399090 |
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 1-Piperidinecarboxylic acid, 3-amino-4-hydroxy-, 1,1-dimethylethyl ester |
| ps-j-088 |
| 2-Methyl-2-propanyl 3-amino-4-hydroxy-1-piperidinecarboxylate |