benzyl 2-nitrophenyl ether structure
|
Common Name | benzyl 2-nitrophenyl ether | ||
|---|---|---|---|---|
| CAS Number | 4560-41-2 | Molecular Weight | 229.23100 | |
| Density | 1.225 g/mL at 20ºC(lit.) | Boiling Point | 377.8ºC at 760 mmHg | |
| Molecular Formula | C13H11NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 170.6ºC | |
| Name | 1-Benzyloxy-2-nitro-benzene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.225 g/mL at 20ºC(lit.) |
|---|---|
| Boiling Point | 377.8ºC at 760 mmHg |
| Molecular Formula | C13H11NO3 |
| Molecular Weight | 229.23100 |
| Flash Point | 170.6ºC |
| Exact Mass | 229.07400 |
| PSA | 55.05000 |
| LogP | 3.69700 |
| Index of Refraction | n20/D 1.598 |
| InChIKey | ZYWSXGRMDPBISP-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1ccccc1OCc1ccccc1 |
| HS Code | 2909309090 |
|---|---|
| Summary | 2909309090 other aromatic ethers and their halogenated, sulphonated, nitrated or nitrosated derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| 1-nitro-2-phenylmethoxybenzene |
| o-Nitrophenyl Benzyl Ether |