Sulfamethoxazole sodium
Sulfamethoxazole sodium structure
|
Common Name | Sulfamethoxazole sodium | ||
|---|---|---|---|---|
| CAS Number | 4563-84-2 | Molecular Weight | 275.259 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H10N3NaO3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Sulfamethoxazole sodiumSulfamethoxazole sodium (Ro 4-2130 sodium) is a sulfonamide bacteriostatic antibiotic[1]. Sulfamethoxazole sodium is used to treat various urinary tract pathogens and in combination with Trimethoprim is considered the gold standard in the treatment of urinary tract infections (UTIs)[2]. |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | sodium N-(5-methylisoxazol-3-yl)sulphanilamidate |
|---|---|
| Synonym | More Synonyms |
This table contains bioactivity, target information and biological‑assay experimental data of this compound.
| Description | Sulfamethoxazole sodium (Ro 4-2130 sodium) is a sulfonamide bacteriostatic antibiotic[1]. Sulfamethoxazole sodium is used to treat various urinary tract pathogens and in combination with Trimethoprim is considered the gold standard in the treatment of urinary tract infections (UTIs)[2]. |
|---|---|
| Related Catalog | |
| References |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C10H10N3NaO3S |
|---|---|
| Molecular Weight | 275.259 |
| Exact Mass | 275.034058 |
| PSA | 111.80000 |
| LogP | 3.01430 |
| InChIKey | LARLNXOUTTUXPN-UHFFFAOYSA-N |
| SMILES | Cc1cc([N-]S(=O)(=O)c2ccc(N)cc2)no1.[Na+] |
| Storage condition | -20℃ |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| Sulfisomezole sodium |
| Sodium sulfamethoxazole |
| Sulfamethoxazolesodium |
| Sulfamethoxazole sodium salt |
| Sodium [(4-aminophenyl)sulfonyl](5-methyl-1,2-oxazol-3-yl)azanide |
| 4-Amino-N-(5-methyl-3-isoxazolyl)benzenesulfonamide monosodium salt |
| SMZ-Na |
| Benzenesulfonamide, 4-amino-N-(5-methyl-3-isoxazolyl)-, sodium salt (1:1) |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of sodium N-(5-methylisoxazol-3-yl)sulphanilamidate? |
| A: InChIKey of sodium N-(5-methylisoxazol-3-yl)sulphanilamidate is LARLNXOUTTUXPN-UHFFFAOYSA-N. |
| Q: What is the polar surface area (PSA) of sodium N-(5-methylisoxazol-3-yl)sulphanilamidate? |
| A: Polar surface area (PSA) of sodium N-(5-methylisoxazol-3-yl)sulphanilamidate is 111.80000. |
| Q: What is the molecular weight of sodium N-(5-methylisoxazol-3-yl)sulphanilamidate? |
| A: Molecular weight of sodium N-(5-methylisoxazol-3-yl)sulphanilamidate is 275.259. |
| Q: What is the molecular formula of sodium N-(5-methylisoxazol-3-yl)sulphanilamidate? |
| A: Molecular formula of sodium N-(5-methylisoxazol-3-yl)sulphanilamidate is C10H10N3NaO3S. |
| Q: What is the English name of sodium N-(5-methylisoxazol-3-yl)sulphanilamidate? |
| A: The English name of sodium N-(5-methylisoxazol-3-yl)sulphanilamidate is sodium N-(5-methylisoxazol-3-yl)sulphanilamidate. |
| Q: What are the storage conditions for sodium N-(5-methylisoxazol-3-yl)sulphanilamidate? |
| A: Storage conditions for sodium N-(5-methylisoxazol-3-yl)sulphanilamidate: -20℃. |
| Q: What is the CAS number of sodium N-(5-methylisoxazol-3-yl)sulphanilamidate? |
| A: CAS number of sodium N-(5-methylisoxazol-3-yl)sulphanilamidate is 4563-84-2. |
| Q: What English synonyms does sodium N-(5-methylisoxazol-3-yl)sulphanilamidate have? |
| A: English synonyms of sodium N-(5-methylisoxazol-3-yl)sulphanilamidate: Sulfisomezole sodium, Sodium sulfamethoxazole, Sulfamethoxazolesodium, Sulfamethoxazole sodium salt, Sodium [(4-aminophenyl)sulfonyl](5-methyl-1,2-oxazol-3-yl)azanide, 4-Amino-N-(5-methyl-3-isoxazolyl)benzenesulfonamide monosodium salt, SMZ-Na, Benzenesulfonamide, 4-amino-N-(5-methyl-3-isoxazolyl)-, sodium salt (1:1). |
| Q: What is the SMILES notation of sodium N-(5-methylisoxazol-3-yl)sulphanilamidate? |
| A: SMILES notation of sodium N-(5-methylisoxazol-3-yl)sulphanilamidate is Cc1cc([N-]S(=O)(=O)c2ccc(N)cc2)no1.[Na+]. |
| Q: What is the LogP of sodium N-(5-methylisoxazol-3-yl)sulphanilamidate? |
| A: LogP of sodium N-(5-methylisoxazol-3-yl)sulphanilamidate is 3.01430. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |
| Dayang Chem (Hangzhou) Co., Ltd. |
| Henan Tianfu Chemical Co., Ltd. |