Sulfamethoxazole sodium structure
|
Common Name | Sulfamethoxazole sodium | ||
|---|---|---|---|---|
| CAS Number | 4563-84-2 | Molecular Weight | 275.259 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H10N3NaO3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Sulfamethoxazole sodiumSulfamethoxazole sodium (Ro 4-2130 sodium) is a sulfonamide bacteriostatic antibiotic[1]. Sulfamethoxazole sodium is used to treat various urinary tract pathogens and in combination with Trimethoprim is considered the gold standard in the treatment of urinary tract infections (UTIs)[2]. |
| Name | sodium N-(5-methylisoxazol-3-yl)sulphanilamidate |
|---|---|
| Synonym | More Synonyms |
| Description | Sulfamethoxazole sodium (Ro 4-2130 sodium) is a sulfonamide bacteriostatic antibiotic[1]. Sulfamethoxazole sodium is used to treat various urinary tract pathogens and in combination with Trimethoprim is considered the gold standard in the treatment of urinary tract infections (UTIs)[2]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C10H10N3NaO3S |
|---|---|
| Molecular Weight | 275.259 |
| Exact Mass | 275.034058 |
| PSA | 111.80000 |
| LogP | 3.01430 |
| InChIKey | LARLNXOUTTUXPN-UHFFFAOYSA-N |
| SMILES | Cc1cc([N-]S(=O)(=O)c2ccc(N)cc2)no1.[Na+] |
| Storage condition | -20℃ |
| Sulfisomezole sodium |
| Sodium sulfamethoxazole |
| Sulfamethoxazolesodium |
| Sulfamethoxazole sodium salt |
| Sodium [(4-aminophenyl)sulfonyl](5-methyl-1,2-oxazol-3-yl)azanide |
| 4-Amino-N-(5-methyl-3-isoxazolyl)benzenesulfonamide monosodium salt |
| SMZ-Na |
| Benzenesulfonamide, 4-amino-N-(5-methyl-3-isoxazolyl)-, sodium salt (1:1) |