1,2,2,3,4,4-hexaphenyl-1,3,5,2,4,6-triazatrisilinane structure
|
Common Name | 1,2,2,3,4,4-hexaphenyl-1,3,5,2,4,6-triazatrisilinane | ||
|---|---|---|---|---|
| CAS Number | 4570-25-6 | Molecular Weight | 591.92400 | |
| Density | 1.19 | Boiling Point | 622.266ºC at 760 mmHg | |
| Molecular Formula | C36H33N3Si3 | Melting Point | 213-214ºC | |
| MSDS | N/A | Flash Point | 330.135ºC | |
| Name | 1,2,2,3,4,4-hexaphenyl-1,3,5,2,4,6-triazatrisilinane |
|---|---|
| Synonym | More Synonyms |
| Density | 1.19 |
|---|---|
| Boiling Point | 622.266ºC at 760 mmHg |
| Melting Point | 213-214ºC |
| Molecular Formula | C36H33N3Si3 |
| Molecular Weight | 591.92400 |
| Flash Point | 330.135ºC |
| Exact Mass | 591.19800 |
| PSA | 18.51000 |
| LogP | 4.57360 |
| InChIKey | NBPZGSOCIPESOP-UHFFFAOYSA-N |
| SMILES | c1ccc(N2[Si]N[Si](c3ccccc3)(c3ccccc3)N(c3ccccc3)[Si]2(c2ccccc2)c2ccccc2)cc1 |
| HS Code | 2902909090 |
|---|
|
~60%
1,2,2,3,4,4-hex... CAS#:4570-25-6 |
| Literature: Gmelin Handbook: Si: MVol.C, 112, page 314 - 316 |
|
~%
1,2,2,3,4,4-hex... CAS#:4570-25-6 |
| Literature: Larsson; Bjellerup Journal of the American Chemical Society, 1953 , vol. 75, p. 995 |
|
~%
1,2,2,3,4,4-hex... CAS#:4570-25-6 |
| Literature: Larsson; Bjellerup Journal of the American Chemical Society, 1953 , vol. 75, p. 995 |
| HS Code | 2902909090 |
|---|---|
| Summary | 2902909090 other aromatic hydrocarbons。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:2.0%。General tariff:30.0% |
| 2,2,4,4,6,6-hexaphenyl-cyclotrisilazane |
| 1H.3H.5H-Hexaphenylcyclotrisilazan |
| 2.2.4.4.6.6-Hexaphenyl-cyclotrisilazan |
| Hexaphenyl-cyclo-trisilazan |
| Hexaphenylcyclotrisilazane |