Dichlorodiphenylsilane structure
|
Common Name | Dichlorodiphenylsilane | ||
|---|---|---|---|---|
| CAS Number | 80-10-4 | Molecular Weight | 253.199 | |
| Density | 1.204 | Boiling Point | 305.0±11.0 °C at 760 mmHg | |
| Molecular Formula | C12H10Cl2Si | Melting Point | -22 °C | |
| MSDS | Chinese USA | Flash Point | 155 ºC | |
| Symbol |
GHS05, GHS06 |
Signal Word | Danger | |
| Name | Dichlorodiphenylsilane |
|---|---|
| Synonym | More Synonyms |
| Density | 1.204 |
|---|---|
| Boiling Point | 305.0±11.0 °C at 760 mmHg |
| Melting Point | -22 °C |
| Molecular Formula | C12H10Cl2Si |
| Molecular Weight | 253.199 |
| Flash Point | 155 ºC |
| Exact Mass | 251.992889 |
| LogP | 6.69 |
| Vapour density | >1 (vs air) |
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |
| Index of Refraction | 1.583 |
| InChIKey | OSXYHAQZDCICNX-UHFFFAOYSA-N |
| SMILES | Cl[Si](Cl)(c1ccccc1)c1ccccc1 |
| Stability | Stable. Moisture sensitive. Flammable. Incompatible with strong oxidizing agents. |
| Water Solubility | DECOMPOSES |
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATA
|
| Symbol |
GHS05, GHS06 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H310-H314 |
| Precautionary Statements | P280-P302 + P350-P305 + P351 + P338-P310 |
| Personal Protective Equipment | Faceshields;full-face respirator (US);Gloves;Goggles;multi-purpose combination respirator cartridge (US);type ABEK (EN14387) respirator filter |
| Hazard Codes | T:Toxic |
| Risk Phrases | R22;R24;R34 |
| Safety Phrases | S26-S36/37/39-S45-S28A |
| RIDADR | UN 1769 8/PG 2 |
| WGK Germany | 1 |
| RTECS | VV3190000 |
| Packaging Group | II |
| Hazard Class | 8 |
| HS Code | 29310095 |
| Precursor 10 | |
|---|---|
| DownStream 9 | |
| HS Code | 29310095 |
|---|
|
Sorption of nonpolar aromatic contaminants by chlorosilane surface modified natural minerals.
Environ. Sci. Technol. 35(21) , 4260-4, (2001) The efficacy of the surface modification of natural diatomite and zeolite material by chlorosilanes is demonstrated. Chlorosilanes used were trimethylchlorosilane (TMSCI), tert-butyldimethylchlorosila... |
|
|
Supports for reverse-phase high-performance liquid chromatography of large proteins.
Anal. Biochem. 104(1) , 153-9, (1980)
|
|
|
Synthesis of poly (silyl ether) by the addition reaction of bisphenol-S diglycidyl ether and dichlorodiphenylsilane. Liaw DJ
Polymer 38(20) , 5217-5219, (1997)
|
| Benzene, 1,1'-(dichlorosilylene)bis- |
| EINECS 201-251-0 |
| Dichloro(diphenyl)silane |
| G-SI-GR&R |
| MFCD00000489 |