2-chloro-1,3-diphenyl-propane-1,3-dione structure
|
Common Name | 2-chloro-1,3-diphenyl-propane-1,3-dione | ||
|---|---|---|---|---|
| CAS Number | 4571-27-1 | Molecular Weight | 258.70000 | |
| Density | 1.239g/cm3 | Boiling Point | 411.6ºC at 760 mmHg | |
| Molecular Formula | C15H11ClO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 173.9ºC | |
| Name | 2-chloro-1,3-diphenylpropane-1,3-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.239g/cm3 |
|---|---|
| Boiling Point | 411.6ºC at 760 mmHg |
| Molecular Formula | C15H11ClO2 |
| Molecular Weight | 258.70000 |
| Flash Point | 173.9ºC |
| Exact Mass | 258.04500 |
| PSA | 34.14000 |
| LogP | 3.35960 |
| Index of Refraction | 1.592 |
| InChIKey | PRRYJBPJSBKURK-UHFFFAOYSA-N |
| SMILES | O=C(c1ccccc1)C(Cl)C(=O)c1ccccc1 |
| HS Code | 2914700090 |
|---|
| Precursor 9 | |
|---|---|
| DownStream 4 | |
| HS Code | 2914700090 |
|---|---|
| Summary | HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| 1,2-chloro-1,3-diphenyl |
| 2-chloro-1,3-diphenylpropan-1,3-dione |
| 1,3-Propanedione,2-chloro-1,3-diphenyl |
| 2-chloro-1,3-diphenyl-propane-1,3-dione |
| 2-Chlor-1,3-diphenyl-propan-1,3-dion |
| 2-chloro-1,3-bisphenylpropane-1,3-dione |
| Dibenzoylchlormethan |