Bicyclo[2.2.1]hept-5-ene-2,3-dicarbonyldichloride, (1R,2R,3R,4S)-rel- structure
|
Common Name | Bicyclo[2.2.1]hept-5-ene-2,3-dicarbonyldichloride, (1R,2R,3R,4S)-rel- | ||
|---|---|---|---|---|
| CAS Number | 4582-21-2 | Molecular Weight | 219.06500 | |
| Density | 1.453g/cm3 | Boiling Point | 243.3ºC at 760mmHg | |
| Molecular Formula | C9H8Cl2O2 | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | 133.5ºC | |
| Symbol |
GHS05, GHS07 |
Signal Word | Danger | |
| Name | trans-5-norbornene-2,3-dicarbonyl chloride |
|---|---|
| Synonym | More Synonyms |
| Density | 1.453g/cm3 |
|---|---|
| Boiling Point | 243.3ºC at 760mmHg |
| Molecular Formula | C9H8Cl2O2 |
| Molecular Weight | 219.06500 |
| Flash Point | 133.5ºC |
| Exact Mass | 217.99000 |
| PSA | 34.14000 |
| LogP | 1.95550 |
| Index of Refraction | n20/D 1.517(lit.) |
| InChIKey | KANQIAARVSWKKG-UHFFFAOYSA-N |
| SMILES | O=C(Cl)C1C2C=CC(C2)C1C(=O)Cl |
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATA
|
| Symbol |
GHS05, GHS07 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H312 + H332-H314 |
| Precautionary Statements | P280-P305 + P351 + P338-P310 |
| Personal Protective Equipment | Faceshields;full-face respirator (US);Gloves;Goggles;multi-purpose combination respirator cartridge (US);type ABEK (EN14387) respirator filter |
| Hazard Codes | C |
| Risk Phrases | R34 |
| Safety Phrases | S24/25 |
| RIDADR | UN 3265 8/PG 2 |
| WGK Germany | 3 |
| RTECS | RB8225000 |
| Packaging Group | III |
| HS Code | 2917209090 |
|
~99%
Bicyclo[2.2.1]h... CAS#:4582-21-2 |
| Literature: Shen, Wang; Garvey, David S.; Cohen, Jerry; Stein, Herman; Rosenberg, Saul H. Bioorganic and Medicinal Chemistry Letters, 1998 , vol. 8, # 8 p. 891 - 896 |
|
~%
Bicyclo[2.2.1]h... CAS#:4582-21-2 |
| Literature: Pulamagatta; Pankaj; Beiner; Binder Macromolecules, 2011 , vol. 44, # 4 p. 958 - 965 |
|
~%
Bicyclo[2.2.1]h... CAS#:4582-21-2 |
| Literature: Moore, Joel D.; Byrne, Robert J.; Vedantham, Punitha; Flynn, Daniel L.; Hanson, Paul R. Organic Letters, 2003 , vol. 5, # 23 p. 4241 - 4244 |
|
~%
Bicyclo[2.2.1]h... CAS#:4582-21-2 |
| Literature: Imp. Chem. Ind. Patent: GB578867 , 1945 ; |
| HS Code | 2917209090 |
|---|---|
| Summary | 2917209090 other cyclanic, cyclenic or cyclotherpenic polycarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives。supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward)。VAT:17.0%。tax rebate rate:9.0%。MFN tariff:6.5%。general tariff:30.0% |
|
Investigation of fine-structure of polyamide thin-film composite membrane under swelling effect by positron annihilation lifetime spectroscopy and molecular dynamics simulation. Huang YH, et al.
J. Memb. Sci. 417-418 , 201–209, (2012)
|
| 3,6-endomethylene-1,2,3,6-tetrahydrophtaloyl chloride |
| endo,exo-bicyclo[2,2,1]-hept-5-ene-2,3-dicarboxylic acid chloride |
| 3,6-ENDOMETHYLENE-1,2,3,6-TETRAHYDROPHTHALOYL CHLORIDE |
| trans-bicyclo[2.2.1]hept-5-ene-2,3-dicarbonyl dichloride |
| trans-bicyclo(2.2.1)hept-5-enyl-2,3-dicarbonylchloride |
| trans-3,6-endo-Methylene-1,2,3,6-tetrahydrophthaloyl chloride |
| EINECS 224-967-5 |
| MFCD00167567 |
| endo,exo-bicyclo[2.2.1]hept-5-ene-2,3-dicarboxylic acid dichloride |
| endo,exo-bicyclo[2.2.1]hept-2-ene-5,6-dicarboxylic acid dichloride |
| trans-5-norbornene-3-dicarbonylchloride |
| (2-endo,3-exo)-bicyclo[2.2.1]hept-5-ene-2,3-dicarbonyl dichloride |
| 5-NORBORNENE-2,3-DICARBONYL CHLORIDE |
| endo,exo-norbornene-2,3-dicarboxylic acid dichloride |
| BICYCLO[2.2.1]-5-HEPTENE-2,3-DICARBONYL CHLORIDE |
| (+/-)-trans-norborn-5-ene-2,3-dicarbonyl dichloride |