4-Dimethylamino-4′-nitrostilbene structure
|
Common Name | 4-Dimethylamino-4′-nitrostilbene | ||
|---|---|---|---|---|
| CAS Number | 4584-57-0 | Molecular Weight | 268.310 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 411.7±24.0 °C at 760 mmHg | |
| Molecular Formula | C16H16N2O2 | Melting Point | 256-259ºC(lit.) | |
| MSDS | N/A | Flash Point | 202.8±22.9 °C | |
| Name | 4-dimethylamino-4'-nitrostilbene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 411.7±24.0 °C at 760 mmHg |
| Melting Point | 256-259ºC(lit.) |
| Molecular Formula | C16H16N2O2 |
| Molecular Weight | 268.310 |
| Flash Point | 202.8±22.9 °C |
| Exact Mass | 268.121185 |
| PSA | 49.06000 |
| LogP | 5.12 |
| Vapour Pressure | 0.0±1.0 mmHg at 25°C |
| Index of Refraction | 1.684 |
| InChIKey | NVLSIZITFJRWPY-ONEGZZNKSA-N |
| SMILES | CN(C)c1ccc(C=Cc2ccc([N+](=O)[O-])cc2)cc1 |
| HS Code | 2921430090 |
|---|---|
| Summary | HS:2921430090 toluidines and their derivatives; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| N,N-Dimethyl-4'-nitro-trans-stilbene-4-amine |
| Benzenamine, N,N-dimethyl-4-[(E)-2-(4-nitrophenyl)ethenyl]- |
| Benzenamine, N,N-dimethyl-4-(2-(4-nitrophenyl)ethenyl)- |
| 4-Stilbenamine, N,N-dimethyl-4'-nitro- |
| benzenamine, N,N-dimethyl-4-[2-(4-nitrophenyl)ethenyl]- |
| Benzenamine, N,N-dimethyl-4-[2-(4-nitrophenyl)ethenyl]-, (E)- |
| N,N-dimethyl-4-[(E)-2-(4-nitrophenyl)ethenyl]aniline |
| N,N-Dimethyl-4-[(E)-2-(4-nitrophenyl)vinyl]aniline |
| 4-Dimethylamino-4'-nitrostilbene |
| MFCD00041877 |
| 4-Dimethylamino-4′-nitrostilbene |
| DANS |
| N,N-DIMETHYL-4'-NITRO-4-STILBENAMINE |